![[ICO]](/icons/blank.gif) | Name | Size |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | - |
![[VID]](/icons/movie.gif) | 20180303.Weird Japanese Monchhichi USB power bank. (モンチッチ).sKddRZai5lY.mkv | 31M |
| 20180305.inside a German yogurt maker, and simple guide to making yogurt..3ur9OPStm_4.mkv | 24M |
| 20180307.Fixing my oil burner and a look at another eBay hand warmer..ei2nnyCltks.mkv | 25M |
| 20180308.Why Fluke are recalling their SM100_200_300 plug-in testers.._KOYt-0WZxg.mkv | 54M |
| 20180309.Fixing two dead LED bulkhead style lights..QVuwzFhhCW0.mkv | 63M |
| 20180311.Does a cattle prod hurt.dZd5_jyhytg.mkv | 24M |
| 20180313.Mini death-dalek camping light is actually safe!.9g8IW7NEerY.mkv | 21M |
| 20180315.Testing carbon fibre heating wire. (with flame test).EulACmPGfzY.mkv | 62M |
| 20180317.Inside the cheapest LED ceiling light on eBay..5stgv8rv_Do.mkv | 40M |
| 20180319.Trying out a Canadian MRE (Menu 6)..qBwJC5BtUGY.mkv | 37M |
| 20180321.Make a Kryptonite pendant..qLo4wwfn1_s.mkv | 99M |
| 20180323.Unusual USB power bank control chip..TYBWNLyJmTM.mkv | 33M |
| 20180325.Inside an old interference suppression plug. (schematic).O42m1BlWc-M.mkv | 30M |
| 20180327.How many diamonds can you smuggle in a 9V battery..tTG3k2jyzd4.mkv | 15M |
| 20180327.Inside a Poundland 9V alkaline battery. (Check polarity of cells if re-using!).jMfmjqMIT3A.mkv | 15M |
| 20180329.Inside a 3D firework LED lamp..DTsMdf5DaPU.mkv | 48M |
| 20180331.Mystery candy-box from Denmark..swN4MI30ows.mkv | 58M |
| 20180331.Why do they even say 'chicken'!!! (nuclear fire noodles) 핵불닭볶음면.FH5vp-VyZFU.mkv | 13M |
| 20180402.Failed lithium cell under electron microscope..ALK8gk3M4VI.mkv | 20M |
| 20180404.Stinky Poundland USB charger and hack of random 'faded' USB lead..1QjHdsuHiFU.mkv | 52M |
| 20180406.Inside a stylish 65W LED photography lamp..w_gENKTcT-8.mkv | 44M |
| 20180407.500V insulation test of a British General USB socket..NW9ljFMxenE.mkv | 65M |
| 20180408.Test of the Yihua 502D USB bench power supply. (With fix!).rz-ndgC6BJ4.mkv | 69M |
| 20180410.1 watt versus 3 watt LED downlights..NfUwCWZO0Qo.mkv | 34M |
| 20180412.USB flesh-burning pen for ladies. Because apparently they do that..aPqHs6TpNug.mkv | 43M |
| 20180414.Inside a very clever LED headlight lamp..CX_uFs5vKc0.mkv | 52M |
| 20180416.Inside a pink ring light for phones..2W-8_rzJUzI.mkv | 34M |
| 20180418.Make a DIY flowing crystals lamp. (Gillian's diamonds.).NQNB9w9RPVM.mkv | 72M |
| 20180420.Reverse engineering of shady lithium button cell charger..JEczJP7UoRU.mkv | 122M |
| 20180422.3-cell lithium power pack with no balancing.E-sqmNRNbUc.mkv | 38M |
| 20180424.Inside a Baymax night light. Plus resistor tweak..ghK6-lQnYbw.mkv | 33M |
| 20180426.USA vs European Dickies work shorts. (completely different).qE7yqh9mk1g.mkv | 21M |
| 20180427.Inside a REAL Snap Power UL certified night light..JqBZQ23TaZg.mkv | 30M |
| 20180428.Designing the Centaur pinball replacement echo card..CUZi39BYPFA.mkv | 58M |
| 20180430.Fake USB power bank kit rating (100,000mAh again).0b-8ZWy0y5c.mkv | 52M |
| 20180502.Totally exploded Hager RCBO (RCD_GFI with overcurrent trip).K3lBJMpPaOU.mkv | 62M |
| 20180504.Solder testing (and candy)..n5adgI97qxQ.mkv | 81M |
| 20180506.Simplest solar light possible, using old phone battery..ycFTxCoNAQk.mkv | 78M |
| 20180508.Testing a large LED COB..9F-WUcJlgko.mkv | 27M |
| 20180510.Fake Omron relays with smoky issues..E8EH2GqzWNU.mkv | 49M |
| 20180512.Customising a cheap disco light with complete new circuitry..rv_Nb-EiPSI.mkv | 64M |
| 20180513.Applying and exposing dry film photoresist and building a PCB..CrdheP3Dwyc.mkv | 110M |
| 20180515.The Manx beard club tests a French MRE military ration..9m_bD-xlh_M.mkv | 135M |
| 20180518.Industrial timer knock-off. (Actually quite well made.).DeMuNXZ5jLc.mkv | 37M |
| 20180519.Mirrorball rotator source of geared AC motor..dvv3ep2nIz0.mkv | 45M |
| 20180520.Neat waterproof lithium cell holder hack..S5yv1ymYYKk.mkv | 28M |
| 20180521.Inside a lamp post connection and cut-out unit..BioanX0RJgI.mkv | 44M |
| 20180524.Manx meet-up 2018..RftekCrF2sM.mkv | 4.7M |
| 20180524.Poundland solar garden light hack..V70QKWMu7dg.mkv | 53M |
| 20180526.The biggest LED COB panel yet! Voltage_current tests..uIspnsBp3o4.mkv | 35M |
| 20180528.Autopsy of faulty LED lamp. 670 volt PSU! with schematic..XC0YPNJo6mA.mkv | 47M |
| 20180530.Faulty British General circuit breaker autopsy..WcxISVcIpCA.mkv | 30M |
| 20180601.Gillian's Diamonds LED crystal remix. Full build..PtqE2iiwlBQ.mkv | 169M |
| 20180603.Inside a wafer-thin USB powerbank..mGs9dLepJWY.mkv | 29M |
| 20180605.'Educational' temperature controller. (In a bad way.).78zYtjTm2yY.mkv | 35M |
| 20180607.Wire stripping machine and questions and answers.UxAARAqAjrk.mkv | 32M |
| 20180608.TOP ECO DIY TIPZ. How to repair LED lamps..k1IjOi9cBsE.mkv | 23M |
| 20180609.Inside a medical wound sucking machine..Bned0VaG268.mkv | 35M |
| 20180611.Safe USB version of the Gillian's Diamonds lamp. (With PCB file.).PCyUxlsRoRc.mkv | 195M |
| 20180613.Inside a near-silent piezoelectric air pump..hKsZUuvtylE.mkv | 49M |
| 20180614.Even BIGGER '200W' COB LED panel tests..ars0N8-jFzU.mkv | 36M |
| 20180615.The Manx beard club tries Century eggs. (contains profanities and dirty talk).Nhz0DpPfhdQ.mkv | 72M |
| 20180617.Defective nightlight autopsy, half-assed fix and improvements..5DT8g4Ry6ZY.mkv | 46M |
| 20180619.Inside an electric fly trap..onERDyIhjAI.mkv | 27M |
| 20180621.Inside an ozone room deodoriser..K816PVC3nho.mkv | 28M |
| 20180623.Inside a Holophane LED street light (slight chromecast glitch)..pbRHlwOsBbg.mkv | 43M |
| 20180625.Easy way to create a protective silicone layer on a solar light..wmEyu-JAsnM.mkv | 18M |
| 20180626.Awesome flesh-burning death lamp. (Germicidal UV).1m0TQjBRcFo.mkv | 26M |
| 20180626.The universe is infinite, but everything is just fine..hZo1J3cxYXQ.mkv | 5.2M |
| 20180629.Q&A while making a custom LED lamp. (storytime)._0Tju5M-8yU.mkv | 219M |
| 20180701.240V Polish Christmas lights with series resistors..PulkOR_c11I.mkv | 47M |
| 20180703.Testing for electric match misfire. (bangs and flames).YPxrc7PPgfw.mkv | 26M |
| 20180705.Another mini piezoelectric air pump. Let's compare the circuitry..ydoKydWKjK8.mkv | 43M |
| 20180707.Faulty light autopsy with 'electronic noise' on the video..ix-BtNXYxZg.mkv | 58M |
| 20180707.New time for Glasgow 2018 meet..QZXurB01FGo.mkv | 3.0M |
| 20180707.Prize competition - The Exploding Kryptonite Game..rneg12Pth3I.mkv | 2.5M |
| 20180710.The Exploding Kryptonite Game. Let's play the game!.9TtY4eFh4yQ.mkv | 3.3M |
| 20180712.Out of date surströmming with the Manx beard club..4vjT_fFUFLs.mkv | 53M |
| 20180713.Glasgow meet reminder. Sun 15th and Mon 16th July 2018..Y6M4tA61hl0.mkv | 2.1M |
| 20180713.Opening the bulging tin of Surstromming (fermented fish)..Q_JRbmgz2ks.mkv | 4.7M |
| 20180714.Well engineered German LED light With schematic and tests..pq6fbHX-jCQ.mkv | 67M |
| 20180715.Car_van keyfob button replacement. (Glitchy video!).LmHdkCW0AaM.mkv | 22M |
| 20180717.The cheapo 'starry' lamp. Good base for lamp projects..QoiiZLBJrIE.mkv | 51M |
| 20180720.Glasgow mini Maker Faire 2018..6618rpgQdMo.mkv | 449K |
| 20180720.Making a wiring loom for a prop. Rambly Q&A video..Xm1rw55IoxE.mkv | 195M |
| 20180722.Autopsy on exploded remote control socket..mVkEDduVQJA.mkv | 67M |
| 20180724.Sweets (candy) from Norway and Sweden..6j_-3JnogRw.mkv | 38M |
| 20180724.eBay radio remote controls. (220V with a 125V relay!).pywKffd8qB4.mkv | 41M |
| 20180727.Inside a burned out Aukey power bank..ieVit5x6PLA.mkv | 29M |
| 20180729.Autopsy on failed 240V LED garden lantern with PIR..3Wrk1F3JuEc.mkv | 29M |
| 20180801.Inside BM Homestores rechargeable LED worklight..ielSQIfuVX8.mkv | 31M |
| 20180803.Autopsy on two dead night lights, one of which emitted smoke..6k9nBCJs_0s.mkv | 32M |
| 20180805.Inside a waterproof LED colour changing light from BM homestores..aVhcU7ncC1Y.mkv | 20M |
| 20180806.Questions for the crew - of the Edinburgh Tattoo..DslfiLOD-2c.mkv | 3.6M |
| 20180808.Airwick mist ultrasonic aroma atomiser..4VljmyydJTI.mkv | 37M |
| 20180810.Solar panel sealing test and lighting experiment..m3AtN9qBJVE.mkv | 27M |
| 20180812.Inside a G9 COB lamp from Poundworld..f_Eyy6wJSsc.mkv | 19M |
| 20180813.Edinburgh channel meet-up for technical chat..YaZbCRUjCiI.mkv | 874K |
| 20180814.Inside the Energizer compact lantern..jNmdCV_-pKM.mkv | 21M |
| 20180814.Mouldy rice pack from Tesco. (Damaged pack.).XBxbACjF2xc.mkv | 5.6M |
| 20180817.Poundworld camping light re-visit..6hi5vdrZ7YI.mkv | 19M |
| 20180819.Edinburgh Hacklab visit for new followspot mount prototyping..Qu_pbyzmZ9Q.mkv | 26M |
| 20180822.Non-contact autopsy of dead sign light. (strobe warning).aMXIJJepQto.mkv | 19M |
| 20180822.The chilli Nutella challenge..ClMnfA81hPI.mkv | 6.0M |
| 20180824.Entertainment industry connectors..6Ay9T3o9OSw.mkv | 24M |
| 20180825.Lighting cowl foolishness with Vince the crew chief..HihvnJyRu7w.mkv | 2.8M |
| 20180826.Edinburgh Tattoo lighting questions part 1..SEpBsSvbupc.mkv | 46M |
| 20180828.Part 2 of Tattoo lighting questions..f19LHFg4mbs.mkv | 35M |
| 20180831.Catastrophic lamp failure in Vari-Lite..ucTEqLtUEJI.mkv | 3.7M |
| 20180901.3rd Edinburgh Tattoo Lighting answers video..u7xV6Kt8tPc.mkv | 50M |
| 20180901.Repairing the light in my accommodation room..ZrjFpHLvTxE.mkv | 13M |
| 20180903.Inside a poundland £5 sealed LED 10W floodlight..G_CgoId951M.mkv | 13M |
| 20180903.Meet Ewen of the Edinburgh Tattoo prop, FX and stage-pyro dept..Q3tdrsMTMys.mkv | 16M |
| 20180905.Meet Moose of the Royal Edinburgh Military Tattoo audio department..JdlzTpOnUR8.mkv | 43M |
| 20180905.Poundland remote control light set. (with schematics).PYPk-60-MfQ.mkv | 43M |
| 20180907.Inside an automatic pencil sharpener..5Ob_ejGM1Yw.mkv | 20M |
| 20180907.Meet the Edinburgh Tattoo main pyro crew..J2_PuWOtPi4.mkv | 36M |
| 20180907.Meet the Edinburgh Tattoo projectionists..AeFRH2v1w4w.mkv | 40M |
| 20180907.Show power distribution. Edinburgh Tattoo..EhhIXWziEbg.mkv | 11M |
| 20180909.Backstage at the Royal Edinburgh Military Tattoo..r_magldaGqU.mkv | 6.0M |
| 20180909.Meet the Edinburgh Tattoo gas-torch crew..fvLzpf5jLbY.mkv | 9.7M |
| 20180912.Amazing ten-volt mercury discharge UVC lamp. (GTL3).aBrLeOVBCaE.mkv | 54M |
| 20180913.Incredible solid state dehumidifier. No moving parts..Vabq-s62IVM.mkv | 55M |
| 20180915.Gifts from the Glasgow meetups..5McPF_LOvU8.mkv | 12M |
| 20180915.Testing a USB powered wall hook and a look inside..Ze8jifMh034.mkv | 35M |
| 20180917.Inside a solar latte milk frother..JTRc0BGD7VI.mkv | 16M |
| 20180917.Inside the new Poundland Power-geek 2200mAh power bank..7VSwMfDANMY.mkv | 39M |
| 20180919.Inside a Dezac ioniser with active dust collection mat..y7QFJgTjzcc.mkv | 59M |
| 20180921.Inside a shitty eBay ionizer with weird circuitry. (with schematic).sE7f6aHlx9A.mkv | 55M |
| 20180924.Poundland Xmas 2018 screw-up deja vu..Bkv2pEqf5VI.mkv | 21M |
| 20180925.The theatre connection of the Co-op spooky flashlight..70MW5Topubk.mkv | 32M |
| 20180927.The most lacklustre rechargeable camping light yet..1MiQBqbiuLk.mkv | 36M |
| 20180929.Inside Poundlands 4000mAh Power Geek power bank..bcJ2H7fS8hQ.mkv | 28M |
| 20181001.Inside a fake Fuxin ionizer lamp. (with schematic).6AQ5c9Emeow.mkv | 20M |
| 20181003.100W LED module (growlight) with schematic..vBdqRigjgkM.mkv | 35M |
| 20181005.MBC Q&A with chemical liqueurs on a stormy night..eoG22MnFG4o.mkv | 196M |
| 20181007.Fix your smoke, snow machine, steam mop solenoid pump..Yz5MP76EuZc.mkv | 60M |
| 20181009.Autopsy of a dead LED lamp from a Japanese sign..qs2AU7NTpiQ.mkv | 39M |
| 20181011.Poundland's VERY annoying spooky Halloween lights..2m9utv54IGs.mkv | 34M |
| 20181013.USB powered photocatalytic inhalation mosquito killer..GiyvGtjSk1E.mkv | 31M |
| 20181014.Torch your home for $4. (with schematic).AOCrG0mOMW4.mkv | 47M |
| 20181017.Adjust your mains voltage with a standard transformer..ZEFVNFyG9po.mkv | 38M |
| 20181018.How to detect shitty and dangerous aluminium flex..R7aa-cJ1ki0.mkv | 11M |
| 20181018.Inside an LED 'Circolux' lookalike.CrmvvMlfb1E.mkv | 67M |
| 20181020.USB rechargeable poop illuminator with piss-flap..sLRsuTcBv3Y.mkv | 44M |
| 20181021.The importance of Franlab. (with competition).ObSarQOaC88.mkv | 26M |
| 20181023.Solar light - cold to warm white conversion. (ambient).ftEEBbTwFgM.mkv | 92M |
| 20181026.Inside a smart meter, and the REAL problem with them..G32NYQpvy8Q.mkv | 49M |
| 20181027.Inside a neat 3D printed and laser engraved sign..Zpyxuf30pYc.mkv | 11M |
| 20181029.Poundland's spooky light projector with decent power supply..S5--HfI6s6E.mkv | 64M |
| 20181031.Inside an 'intelligent' emergency lamp (with schematic)..nnXkQmswNJ4.mkv | 47M |
| 20181102.Inside a Xiaomi Mijia mosquito repeller. (Including cartridge reset info.).sP7j-TqPshI.mkv | 47M |
| 20181106.Crappy lead-acid LED lamp with brilliantly simple circuitry..sax9unx76Kg.mkv | 48M |
| 20181108.Inside a self-testing emergency exit sign..9VQXTsjTe9k.mkv | 50M |
| 20181110.Poundland Xmas 2018 light-fest. With Royal blasphemy..L-Qn5NkYnz4.mkv | 73M |
| 20181112.Modifying an old light with LED tape..7_ds5XFJvPs.mkv | 116M |
| 20181114.Poundland 'disposable' phone charger..6lflk6iY56w.mkv | 41M |
| 20181116.Poundland lights unexpected feature and USB mod..gJKy20wfIvg.mkv | 56M |
| 20181118.Inside an American emergency light (with schematic)..KbjLZmAWEmI.mkv | 44M |
| 20181120.What's in a tin of foaming tyre repair liquid..LeE2cL_mCdA.mkv | 21M |
| 20181122.Very impressive B&Q LED Xmas lighting frame. (Too much maths).0yCgRsYXD6I.mkv | 75M |
| 20181124.Cheap eBay dimmer module vs compliant dimmer. (Schematics).w71Qr1ygB_Y.mkv | 76M |
| 20181126.Inside a dodgy rechargeable touch light..QbWoBNchV90.mkv | 29M |
| 20181128.Making Kryptonite Christmas lights..E4EoTkigmLw.mkv | 28M |
| 20181130.USB rechargeable flame lamp teardown (with schematic)..8NMXQXKVirk.mkv | 61M |
| 20181204.Inside Poundland's orb 360 robot COB light..WSatFTp9sUE.mkv | 22M |
| 20181206.Kryptonite tree and MBC Canadian candy tasting..XvUXlih9b_c.mkv | 96M |
| 20181207.inside a computerised pipework scale reducer..QnahQPSKCcA.mkv | 52M |
| 20181210.Unprotected phone battery copies..ZAeOkaEFPLA.mkv | 25M |
| 20181212.12V LED filament lamp video disaster..pu6usLoz2GM.mkv | 53M |
| 20181214.Neat conical LED festoon lamps..4B97gkRcwXA.mkv | 33M |
| 20181215.Dead Starbucks charger and devious thoughts..VsRwfDAP5As.mkv | 3.7M |
| 20181216.How the brilliant automatic iodine cotton stick works..ivpU-4LJaZk.mkv | 17M |
| 20181218.Beautifully simple 12V glass LED filament lamp..En8-2V-Pkm8.mkv | 31M |
| 20181220.Inside a Chinese electrically heated lunch _ bento box..VL0hHm9bsjY.mkv | 47M |
| 20181222.Poopy Poundland Power Pod Brexit special..ID1klW5GYdk.mkv | 27M |
| 20181224.Cheap LED ropelight unboxing and analysis..Ssitg_xcAiI.mkv | 37M |
| 20181224.MBC Christmas special 2018..S8QO1BYVev4.mkv | 250M |
| 20181225.Christmas greetings from the Irish Sea..PeS1-R9stZY.mkv | 2.3M |
| 20181225.eBay smoke machine MELTED..8ZGGgb3iFpg.mkv | 68M |
| 20181228.Poundland purple gothic death-star hack..axEqM8eBuxY.mkv | 70M |
| 20181230.Inside a sealed Chinese Solar street light with Doppler detection..kGi7Y-mB_OY.mkv | 128M |
| 20190101.How I test lithium cell and power bank capacity..OaZxLxgf7Ro.mkv | 46M |
| 20190103.LiFePO4 versus standard lithium cells..53n2pw5M9m4.mkv | 33M |
| 20190104.Vintage disco buckle light. (with schematic).8tf7x02AyRA.mkv | 48M |
| 20190106.Inside an interesting light and power bank with hidden upgrade..jBrBBmA_Rjo.mkv | 34M |
| 20190106.Reset your Ruideng USB meter to English..99qP7rXDOyU.mkv | 1.8M |
| 20190108.Hacking a neat machined aluminium flashlight adaptor for power bank. (Strobe warning.).wL8MYTPIuZk.mkv | 62M |
| 20190110.Sensibly designed USB rechargeable PIR cupboard_hallway light..GSkzXqkWayg.mkv | 59M |
| 20190112.Inside the Project MC2 video purse. (Actual video wall panel!).CyLCwa2mneY.mkv | 42M |
| 20190114.Replacing the Amecal meter (and others) rotary selector plate..QMEeB-WVdbw.mkv | 49M |
| 20190116.Inside a Shiny Probe head torch with detachable USB light..5f7_AI9H3N4.mkv | 60M |
| 20190118.Random opening, thoughts and mods to a chunky uplight..Qt4QvuZKgGw.mkv | 38M |
| 20190120.A look inside the Duracell PB2 power bank..W5anaHXMrhk.mkv | 50M |
| 20190122.Faker-shaker. Fake 'eco' flashlight..Ujio2shR7Lg.mkv | 29M |
| 20190124.Full clock kit build and setting guide..BOgddrIXNkY.mkv | 126M |
| 20190126.Driving video wall panels. (including free test software)._dB1w99AwGE.mkv | 70M |
| 20190128.How the OBD2 performance chip power booster and ECU remap module works..zx8fywphQp0.mkv | 70M |
| 20190130.British weatherproof socket with clever design. (bonus rant).lqOzWunmKdE.mkv | 43M |
| 20190201.Inside a chunky USB rechargeable work-light power bank..NAoISQaA5jY.mkv | 45M |
| 20190203.Cleverly designed LED wall light with hackability..X--Y-pvRgRo.mkv | 37M |
| 20190205.Teardown of a self powering machine..1H7SZO4okXk.mkv | 35M |
| 20190207.Poundland glue gun test and teardown..obMjAoMoESE.mkv | 51M |
| 20190209.The next generation COB LED (Radical new style of bare LED chip.).hpF5O0W8Bdg.mkv | 56M |
| 20190211.Inside a hand grip strength tester - dynamometer..fK6GQVkIpno.mkv | 30M |
| 20190213.Inside a pocket clip USB rechargeable pen light..8XqxQsWgxv4.mkv | 28M |
| 20190215.Random prototype LED 'thing' (surface mount).PaoeKX1DHa4.mkv | 110M |
| 20190217.BigCliveLive..R5_m_3eHuQo.mkv | 406M |
| 20190217.I Think I Broke Youtube..aPBnhqeobt0.mkv | 7.5M |
| 20190219.Another cheap eBay LED floodlight. Is it really going to be 50W.H00ppsLjD_U.mkv | 36M |
| 20190221.Inside a simple vintage disco light. (Single Derby.).60uGMBp0seg.mkv | 14M |
| 20190223.Real shaker light versus a Nitecore Tube..K1BpfpO9BfY.mkv | 16M |
| 20190225.Inside a Timeguard coolglow nightlight with unusual glow tube..QmaqagBNsMQ.mkv | 35M |
| 20190227.Simplest OBD2 engine remapper yet, with actual canbus connection..PB810U7j77k.mkv | 48M |
| 20190301.Odd pinhole leak in copper pipe. Selective electrolytic corrosion.HDF3qRLw7CM.mkv | 18M |
| 20190303.Entertainment industry 400A powersafe connectors..tTakz9rYIqY.mkv | 42M |
| 20190305.Autopsy of failed grow light and test of actual power versus stated power..NfR9qAm9SsA.mkv | 60M |
| 20190305.MBC Pancake Day Q&A..tV1T4_B-ezE.mkv | 414M |
| 20190307.Inside a faulty Puripod ozone generator..XJ3TBUQjt_8.mkv | 57M |
| 20190308.Self contained vehicle door warning strobe lights..xY7Rc10U3Cg.mkv | 38M |
| 20190311.How a genuine Scotsman makes his porridge..F6ofLi_Rd2U.mkv | 35M |
| 20190313.Vype teardown and two ways to refill..nvjqbbaYGiE.mkv | 107M |
| 20190315.Flashing USB rechargeable dog collar teardown..ah6IUtLlDXg.mkv | 32M |
| 20190317.Turbo charging a 120V Presto hot dogger on 250V..n2ZZbuOeNmw.mkv | 25M |
| 20190321.Cheap imported 'rainproof' power supply (long version)..QaseIHFEn0Q.mkv | 67M |
| 20190321.Cheap imported 'rainproof' power supply (short version)..GInptwvmj_s.mkv | 24M |
| 20190323.Astro Pneumatic light versus clones (teardown and schematic).RB6_T5Eq8uk.mkv | 71M |
| 20190325.Inside a faulty Kärcher window vac..P9WpN-Trt50.mkv | 43M |
| 20190327.Cheap eBay illuminated panel push button..0m_52yN3AE0.mkv | 47M |
| 20190329.Inside a heat detector alarm. (Not a smoke detector.).F070CWlaM7o.mkv | 53M |
| 20190331.USB to PIR to LED-string interface PCB..ZE5JASv3XyY.mkv | 106M |
| 20190402.Inside an Indian mosquito plug-in vapouriser_vaporizer..okRxI8-iuxs.mkv | 57M |
| 20190404.A look inside a British home electrical panel..2R3L_nvNP6Y.mkv | 46M |
| 20190406.UK versus USA canned hot dog electrocution challenge. (mastication alert).bnFkCZCsikU.mkv | 25M |
| 20190408.Poundland night light tungsten to LED evolution. (with schematics)._AuC5dlJB3E.mkv | 51M |
| 20190410.240V bananacuting bananticlimax. (mastication alert).QTzgWrq41LY.mkv | 13M |
| 20190412.Teardown of a '27W' ultraviolet blacklight bar from eBay..GkKWyuvy48Y.mkv | 46M |
| 20190414.A look inside a blown 36kV fuse..xfVc_5M_2_c.mkv | 30M |
| 20190416.Stacking industrial switch contact blocks. Actuation force test..njF5xK2KnZw.mkv | 42M |
| 20190418.Storytime. Glasgow's George Square Christmas lights..yPqpflkdt2o.mkv | 172M |
| 20190420.Testing and tearing apart some 12V LED neon-flex..xEXQ9e9vKcA.mkv | 60M |
| 20190422.Under the gel and phosphor of a COB LED car lamp. (Deep violet chips).y7nbHzi1T9o.mkv | 25M |
| 20190424.Thick, black ribbed overhead power lines. Including ABC termination..8JFfXZt7QoI.mkv | 60M |
| 20190426.Teardown of an old British Wylex electrical fuse box. (with bare fuse wires).0L0p5Rk7hZU.mkv | 58M |
| 20190428.A close look at the sliding contacts in a cordless appliance base..-t2HYLSmwfc.mkv | 19M |
| 20190430.British home wiring. The incredibly simple lighting circuits..DMS60qvcOiw.mkv | 80M |
| 20190502.Make caramel candy fizzling fire paper. (slight house combustion risk).-96io8Rk-e8.mkv | 33M |
| 20190504.Live sausage-fest with the MBC..v0MrmkE46k0.mkv | 468M |
| 20190506.Limited edition prototype kit LED coaster build and giveaway..Umi6K7xwIBk.mkv | 126M |
| 20190508.All-Out fan assisted mosquito killer teardown. (With schematic.).L49oHi_v07c.mkv | 44M |
| 20190510.How microwave body detectors work. With RF section schematic..Hf19hc9PtcE.mkv | 69M |
| 20190512.CAT S61 video glitching and a mass produced grow light..ViixPyuBSlA.mkv | 46M |
| 20190514.Combustible fluffy USB powerbank. With flame test..FiRqJ40a1Ak.mkv | 41M |
| 20190516.Inside a deformable LED robot lamp..aypiNdcDjEY.mkv | 50M |
| 20190517.Friday Night Clive..xIqBOezG_YQ.mkv | 203M |
| 20190519.German chocolate and USB insect vaporisers..lZNxUydFVAw.mkv | 36M |
| 20190521.Poundland LED neon-style toucan teardown. (It's very well made.).b30T7lbAF_Q.mkv | 23M |
| 20190524.Inside a 125A DC circuit breaker. Unexpected arc quenching feature..w0ntxqTEqyM.mkv | 36M |
| 20190526.Simplest power bank ever.3GXdXsIJPGs.mkv | 35M |
| 20190528.Failed 3-phase RCD_GFCI from a Rolec electric car charging pillar. (with schematic).4vGmcdisUr8.mkv | 47M |
| 20190529.In memory of Aussie50..qjSCohaFe4U.mkv | 6.0M |
| 20190530.Bubble wand with unusual bubble generator..BvQtl3ciGcA.mkv | 31M |
| 20190601.9 LED headlight Elfeland teardown..gyWeBwFkhGo.mkv | 55M |
| 20190603.Second Autobot lamp with RADAR sensor..zuw3GsR22TA.mkv | 57M |
| 20190605.Fixing an ezOutlet with inappropriate components..bTgH2N7Dr0M.mkv | 47M |
| 20190607.How a washing machine door interlock with time delay works. (not a wax motor).PIm7q_U3UEM.mkv | 61M |
| 20190609.Inside the Hopi power meter. (It contains a smart meter chip!).2HQGXZU2d4I.mkv | 40M |
| 20190611.Making a set of retro neon fairy lights. (100 year anniversary.).7MZYo-WcZRs.mkv | 177M |
| 20190613.Clone of Wago product that Wago don't even sell.OP86SxqP7I8.mkv | 31M |
| 20190615.Unusually cheap and crappy machine control station..lI6VeSiDPKQ.mkv | 29M |
| 20190617.Inside a Grundig solar wall light. (rebranded).AMI_6KPOxmU.mkv | 26M |
| 20190619.Teardown of a hot air coat hanger for drying clothes..0EPzPQ2tfJU.mkv | 89M |
| 20190621.Custom bright or shimmery neon lamp. Your choice..BWu_1RPYkBo.mkv | 84M |
| 20190623.Dead JBL speaker and melted PSU. Which died first.8fJ6gQc-6X8.mkv | 49M |
| 20190625.Inside a bottle air vent and plumbing ramble. (No electronics whatsoever.).1OnxLxqfIsE.mkv | 46M |
| 20190627.Shady PIR ceiling light analysis. (With flame test.).FEEXGGwrs_Y.mkv | 85M |
| 20190629.Inside a 13,500A surge protector. (With schematic.).wIQYbs09vGg.mkv | 35M |
| 20190702.inside a linear LED light with Samsung LEDs..mD4zn9IA5Ec.mkv | 70M |
| 20190703.Silicone sealed solar lights one year update..czfa0S5uwcI.mkv | 64M |
| 20190705.Testing random meters for accuracy with DIY resistance tester..IDsIpBVCi04.mkv | 55M |
| 20190707.Repairing a rather nice 100 LED lamp..VhFbW8GieEM.mkv | 35M |
| 20190709.Technical bibles of showbiz. (And neon.).WOfghE59jq0.mkv | 71M |
| 20190711.Technical look at a floating solar fountain..y9BvhPG-rQE.mkv | 41M |
| 20190713.My Blu teardown and refilling..eWxwoJgvZIA.mkv | 75M |
| 20190714.Sunday Night Clive..J1_SussTFW8.mkv | 500M |
| 20190717.Resurrecting dead power banks from Russia..v1RpQbImoqQ.mkv | 90M |
| 20190719.Inside a rather good USB rechargeable head-lamp from eBay..sXZJhWpGHYU.mkv | 87M |
| 20190721.Opening a sparkly lamp with a spiral of LEDs. (With schematic).4N_HowAqKd4.mkv | 57M |
| 20190723.Vac formed LED 'neon' sign. Genius or tacky.wy4q_-5cRuM.mkv | 8.4M |
| 20190725.ASDA 12W (100W) LED filament lamp teardown. (with schematic).t3HpPikRDeY.mkv | 36M |
| 20190727.What colour are your eyes Does it affect your career choice.aHdAd_hYHlg.mkv | 10M |
| 20190729.Four types of LED 'neon' sign manufacturing technologies..tKKQcWefcko.mkv | 24M |
| 20190801.Inside a tiny 'fireplace' lantern.._vNdK_HPT8Q.mkv | 28M |
| 20190803.Inside the Aldi 5W LED bulkhead light. (With schematic.).Bv0kdFyYEAU.mkv | 40M |
| 20190805.Inside a pre-smashed Sainsbury's stand-alone light..T7ESvCd79TE.mkv | 19M |
| 20190807.Why RGB LEDs don't always work in solar lights..FsA79XdV1wk.mkv | 15M |
| 20190809.Inside a humble Poundland computer mouse..NwfZBRTqXFY.mkv | 31M |
| 20190811.Edinburgh meet-up 2019. (now over).LAb2SBOD1sg.mkv | 1.5M |
| 20190811.Inside Poundland's keychain COB light. (Good for the components.).crO-BpU4ZCM.mkv | 17M |
| 20190813.Inside the awesome Argos laser sphere. (with schematic).00RMEOldq3M.mkv | 56M |
| 20190815.Inside a solar_mains rechargeable fan _ work light. (with schematic).4mvMScvexjc.mkv | 43M |
| 20190817.Inside Poundland's £2 bubble machine..p2XGtwJCbok.mkv | 27M |
| 20190821.Failed 2D LED replacement lamp. (with schematic).EILh7oZMGbM.mkv | 26M |
| 20190823.Flappy solar ornaments have an interesting history..MHRxYtVD1IU.mkv | 29M |
| 20190825.Inside an Aldi solar security light..4Ot2IF_6py0.mkv | 16M |
| 20190827.Inside Lidl's Livarno solar light strip..JbMwZ0Zlcck.mkv | 28M |
| 20190829.Backstage at the Edinburgh Military Tattoo..7GNiiGrKWBY.mkv | 80M |
| 20190829.Backstage at the Tattoo the 'music' bits..htelX64u1Ng.mkv | 18M |
| 20190829.Glasgow meet 2019 (Now past.).wQ5nsQ5o-KA.mkv | 868K |
| 20190831.Inside Sainsburys solar garden lighting string.._X-zrEAW3qU.mkv | 14M |
| 20190902.Inside Poundland's electric fly zapper bat. (with schematic).vvXZM6kg_gI.mkv | 23M |
| 20190904.The Shrimps & Bananas live stream 4th Sep 2019..xIm6QUV5nZc.mkv | 593M |
| 20190906.A proper Alzheimer's video..jRltbhRO-sY.mkv | 94M |
| 20190908.Inside a vintage PC gameport analogue trackball..05t6VXcTy98.mkv | 12M |
| 20190911.Vaping deaths media frenzy.4SX9yYVscEo.mkv | 34M |
| 20190913.Inside a pink Pound shop light..b9NsbOCUsUQ.mkv | 6.4M |
| 20190916.Poundland Pifco Penny-Pinching LED lamp. (Hack and schematic.).RKRz7EplgDE.mkv | 83M |
| 20190918.Autopsy on a badly designed solar light (no lithium charge control)..ruEWFdlZnmA.mkv | 40M |
| 20190921.Fixing a dead LED street light lamp. (SOX retrofit.).E78oiWiiv6s.mkv | 74M |
| 20190924.Polish MRE. Sausages in sauerkraut. (Bigos z kielbasa).l1fLls5suL4.mkv | 34M |
| 20190927.Inside a Samsung LED retrofit tube. (Older style).kOAaTMXiDCY.mkv | 70M |
| 20190929.MBC testing more American military rations. Contains dirty talk..N5woSyBlqAc.mkv | 316M |
| 20191001.Quartz clock pendulum movement teardown with schematic..OuC_qoJVhaM.mkv | 34M |
| 20191003.Make shimmering drinks that glitter with E555 (mica)..FjOjI56vUuE.mkv | 40M |
| 20191005.DIY keychain DMX tester for lighting technicians..skwUNRp-Rrk.mkv | 64M |
| 20191007.LED 'neon'. A new and interesting miniature variant..cR-bepWcplc.mkv | 37M |
| 20191009.Breaking a drinking lucky bird completely..OMv2KyuZEp4.mkv | 61M |
| 20191011.Make peanut toffee or tablet FAST with easy clean up..jczLRNVZrz8.mkv | 12M |
| 20191013.Mystery corks, PCBs and fixing a dead lamp..haaI0ht18J0.mkv | 49M |
| 20191015.Mega Raizin car fuel saver and booster..ISt_G_cBwbY.mkv | 47M |
| 20191017.100 LED solar garden light teardown (with schematic)..DH4zTmrdc1o.mkv | 45M |
| 20191019.Adding electrolyte to a fake (dry) capacitor..IAQClL3bZzg.mkv | 51M |
| 20191021.eBay meteor _ icicle lights 2019. New circuitry. (With schematic).XdPyuIehDyE.mkv | 68M |
| 20191023.Poundland USB LED tape..bBZ6fwFn3mo.mkv | 11M |
| 20191025.Inside a chunky 7W PAR30 LED landfill lamp. Good hack potential..bstL84kumXo.mkv | 28M |
| 20191027.Poundland's big brown knobbler and other Halloween treasure..h_BtBzg4kMA.mkv | 48M |
| 20191029.How to set your 3D LED digital wall clock..YpF4rXvSfRY.mkv | 15M |
| 20191029.Inside a large '3D' digital clock..M8zjiershdI.mkv | 53M |
| 20191031.Scavenging a THICC lithium cell from a Poundland ALEXA charger..6EBgCkwjxl0.mkv | 57M |
| 20191102.Testing USA MRE 16 - Chicken burrito..6WIhazppXf4.mkv | 56M |
| 20191104.Fixing a microwave body detector..Vycb5ptfkJg.mkv | 37M |
| 20191106.Inside a very stylish long-filament LED lamp..GD_BLc3R4N8.mkv | 61M |
| 20191108.Building the Dept of Villainy LED neon controller..qfOardiykPs.mkv | 205M |
| 20191110.British plugs with built-in surge arrestors. (With schematic.).6LG8YqUmF5U.mkv | 20M |
| 20191111.First livestream over on the new live channel tonight..6SjEDhjLB_8.mkv | 5.4M |
| 20191112.Poundland cat treat test with China and Hutchey..zrLK0xfBP6w.mkv | 21M |
| 20191115.Soda siphon teardown..5U7VY3452ww.mkv | 52M |
| 20191117.Very hackable LED star light..P2pbHegP-BU.mkv | 33M |
| 20191119.Low class inline dimmer from eBay. (with schematic).VjAd7dGZ41w.mkv | 57M |
| 20191121.Using salvaged lithium cells to power LEDs directly. (with protection test).W8VpNJs6ek0.mkv | 92M |
| 20191123.DIY solar garden light project. Surface mount remix..AEnYRXr1_ww.mkv | 95M |
| 20191125.Making and testing polymer gel (slime)..lkgNnTk-nP0.mkv | 42M |
| 20191127.Inside a cheap eBay motor-start module..oZTfYqgYExY.mkv | 59M |
| 20191129.Head torch shorts out 18650 cell while not being used!.l9gkxCNjOhg.mkv | 39M |
| 20191201.Inside a Japanese anti-mosquito lamp..6-pJGrlcu5A.mkv | 36M |
| 20191203.Department of Villainy tree 2019..M9kSbnm5XrI.mkv | 18M |
| 20191205.John Lewis Glasgow Christmas stuff 2019..qDu8Y3Qp-1Y.mkv | 53M |
| 20191207.Inside a Japanese street light time switch..NizwfGn6UGw.mkv | 50M |
| 20191209.Naughty CANbus odometer 'interface'. (Fakes mileage.).f4af1OBU5nQ.mkv | 43M |
| 20191211.Dollar tree VS Poundland LED lamp and hack..YeWnHnZ-ojw.mkv | 81M |
| 20191211.MBC live stream on other channel (linked in description).ykPIU7QGQbw.mkv | 1.4M |
| 20191215.Inside a recalled Amazon Basics power bank..BCFeULqGkLk.mkv | 73M |
| 20191217.My favourite industrial connector (Ceeform)..feCZs9YpH3M.mkv | 52M |
| 20191219.Chinese automatic house ignitor. (also available in pink).vivbspvywKo.mkv | 57M |
| 20191221.Fixing a faulty remote power switch..uhSlA-TAIpI.mkv | 66M |
| 20191223.9000 hour LED intensity loss test on LED strings. (All LEDs do still work.).4lXCWiEqwxM.mkv | 33M |
| 20191224.Zapping pies with 240 volts and eating them. (Not while powered.).DPwfbYtvUOw.mkv | 48M |
| 20191227.Dangerous DIY Krampus LED foliage lamp..2OHtsXdCDGQ.mkv | 163M |
| 20191229.A pleasant waste of time..o5kg16_63GQ.mkv | 9.8M |
| 20191229.Free lithium cells from discarded vapour devices. (And total teardown of one.).ZsWLvr-dsvc.mkv | 51M |
| 20191230.2019 NYE live stream at 9pm (UK time) 31st December 2019. (On other channel.).uaRDLqs6FWc.mkv | 822K |
| 20200103.Inside an electric vehicle charger interface..DAij_wWeZiY.mkv | 57M |
| 20200105.Babybel vs 240V cheese-o-cution. (It really stinks!).ocpkwS6rVTg.mkv | 18M |
| 20200107.Why you can't mix LED and tungsten in series circuits..ukCN_x8TyYk.mkv | 46M |
| 20200109.All plastic 150W eBay desk mini-heater. (With schematic.).iB0jyFFZvYk.mkv | 56M |
| 20200111.Inside a Marq LED smoke machine from CPC. (With schematic.).N-6QNhkEIYQ.mkv | 67M |
| 20200113.3D printed LED test-tube lamp. (with adjustable 3D openSCAD file).vNucN3ZW8Vg.mkv | 60M |
| 20200115.Dangerous imported smoke machine. (with 240V XLR socket).ik_0Z46y6-g.mkv | 62M |
| 20200117.Scottish army ration (MRE) with radioactive heater..9Ry4QBQejFU.mkv | 43M |
| 20200119.DIY Chinese street light kit..zGjM2Mp5IfU.mkv | 40M |
| 20200121.FULL-FAT Babybel versus 250V cheesemageddon.._gUOYDzyrK4.mkv | 15M |
| 20200123.Taste testing an out of date Lithuanian MRE military ration. (minor explosion).R64ee0DO0pU.mkv | 62M |
| 20200125.Is CHEESE the FUTURE of lighting technology.vd9MP3k8tsE.mkv | 24M |
| 20200127.Inside a 2W LED minimalist lamp and pointless (but fun) 3D printed junk..mN2hsAq-LlA.mkv | 26M |
| 20200129.Make a 3D printed USB powered LED energy crystal..orOaQHuhr2g.mkv | 95M |
| 20200131.The inner secrets of eBay and Amazon LED lighting festoon..Nrs0Tft6bHw.mkv | 49M |
| 20200203.How the Brother label printers laminate the label..W2SRePOg4VM.mkv | 73M |
| 20200206.Fixing a faulty battery PIR light that was draining the batteries fast..ZmujSZZvmxs.mkv | 40M |
| 20200207.240V solar lead acid LED head torch. (With schematic.).IMYaWd_wuf8.mkv | 65M |
| 20200209.New Poundland head torch is actually really neat..EqLyzBJidYY.mkv | 27M |
| 20200211.Building an eBay power filter kit (with schematic)..uItTnwgY8Ok.mkv | 69M |
| 20200211.How your three stage home energy pacifier and harmonizer works..LAkz1f2sMDU.mkv | 2.1M |
| 20200213.The almost regrettable neon fairy light project..5iJ2QkbCYIo.mkv | 36M |
| 20200215.Inside two different body detox foot spa electrodes..FDaT3FG7bws.mkv | 30M |
| 20200217.LIDL Philips PIR LED ceiling light teardown..SnHHvGRhHoQ.mkv | 37M |
| 20200219.Custom extra weird trashy lamp build. Blue orb with green pulsars.7-sSnZTu9SM.mkv | 187M |
| 20200221.Surprisingly good pound shop LED flashlight..BZkmIhnoslg.mkv | 12M |
| 20200223.Not ALL negative ion generators are radioactive!.qburvV_t8sE.mkv | 32M |
| 20200225.'Shocking' disco light with 50_60Hz dance feature. (Live chrome case.).MotRPBQVNZg.mkv | 32M |
| 20200227.Is this the new COB flashlight standard.5vXE3gkVhV4.mkv | 10M |
| 20200229.eBay glow in the dark powders and a little bit of deception..LbqX4j5XieQ.mkv | 35M |
| 20200303.Scavenging a decent 280mAh lithium cell out of a disposable item.sqJFsonW85I.mkv | 35M |
| 20200304.Emergency DIY hand sanitizers (read the description).dgY04l0CuEs.mkv | 20M |
| 20200307.Inside an ionic foot detox spa unit..qnXTvU6-xLQ.mkv | 53M |
| 20200309.Crimping tool test that I screwed up. (Read description.).DXLmuDbcLBM.mkv | 76M |
| 20200311.Inside a faulty Aldi dehumidifier..boytzuOOFqY.mkv | 48M |
| 20200313.Solar powered buddha chanting flower..baCLqPzuiF8.mkv | 43M |
| 20200315.This USB rechargeable LED head torch is really good! (And no strobe!).6QaFf3M54Bs.mkv | 34M |
| 20200317.Making glow in the dark ripple blocks to test the aqua strontium colour..kTgCacrAlEA.mkv | 30M |
| 20200319.Make Deep-Heat toilet paper and sanitise your bottom..X7dzQFk81rU.mkv | 7.3M |
| 20200321.Inside a UK compliant dusk sensor switch. (with schematic).cQDIb09cLug.mkv | 58M |
| 20200323.Radioactive 'health' pen from eBay..l-XPsHiNJec.mkv | 25M |
| 20200325.Very useful LED pin-spot light that is a good base for customisation..e_VaWL4ltXE.mkv | 80M |
| 20200327.eBay's cheapest pile of crap USB rechargeable LED head torch..svZMwTb4Iqo.mkv | 58M |
| 20200329.Flickering blue LED cast into glowing resin obelisk..srNRyJ1iAUc.mkv | 38M |
| 20200331.3KV test of cheap disco light with circuit analysis..xyO4xq23zDs.mkv | 148M |
| 20200401.Live-build 3kV positive ion dust collector PSU..B4RTrjABi3M.mkv | 260M |
| 20200402.How to use a UVC germicidal lamp SAFELY..2T39BHvrHZ0.mkv | 12M |
| 20200405.Inside a very British ioniser. (And how they fell out of favour.).VQ1Mw8nMKr0.mkv | 49M |
| 20200407.5G death beams are rubbish for killing your foes..Du8yQeQdMBk.mkv | 68M |
| 20200407.The drunken history of theatrical fog effects.bySTH6H_REs.mkv | 62M |
| 20200409.How a Manfrotto-style magic arm clone works..yfE00pXkL8U.mkv | 34M |
| 20200412.Inside a stylish tabletop UVC germicidal light. (Skin, eye and lung hazard).aaVnAO1Vv-k.mkv | 44M |
| 20200415.Heat shrink solder butt connector test..unxEdyW8RP8.mkv | 22M |
| 20200417.Inside a pink plastic 500W heater from eBay. (Good for parts.).-pqTtpdH7-E.mkv | 39M |
| 20200419.One year test of the CAT S61 thermal imaging phone..Ex7mNzhZN9A.mkv | 54M |
| 20200421.LED lamp with tiny 5kV high voltage ion module. (inc schematic).tl0g_z25xqo.mkv | 64M |
| 20200423.8-year service on an extreme DIY LED light..nN0pYZYcECs.mkv | 27M |
| 20200425.Inside a USB rechargeable incense burner..ZsgPORimlqQ.mkv | 47M |
| 20200427.Fake UV disinfection lamp from eBay..LEVFKHiOfRs.mkv | 48M |
| 20200429.More fake UVC 'sterilizing' lamps from China! (with schematic).yqiVhtsMGWo.mkv | 38M |
| 20200501.Taming down the live-stream lighting..Hu6y-qZfZjY.mkv | 16M |
| 20200503.Testing UVC lamps with a cheap UVA_UVB sensor..7wibGVQpHCc.mkv | 27M |
| 20200505.Autopsy on Thomas Nagy's bike battery charger..Z7d7JK4iQv4.mkv | 31M |
| 20200507.Teardown of a fake UVC germicidal corn-cob lamp.._EVw_AhPJ7E.mkv | 38M |
| 20200509.LED chaos panel build. 54 independently flickering LEDs..jVpUe46yaUE.mkv | 57M |
| 20200511.USB powered disco light mod and solder reflow disaster..sWjRAizFKho.mkv | 45M |
| 20200513.Failed MK RCBO circuit breaker (with awkward recording moment).8kWIITspYvk.mkv | 46M |
| 20200513.UVC. The green banana test..7lzq6LuVWH0.mkv | 8.2M |
| 20200515.Replacing my Breville Hotcup power switch..b0UM1Uvdb48.mkv | 40M |
| 20200517.Inside a Rentokil _ Victor electronic mousetrap..R476G9nmFJ8.mkv | 53M |
| 20200519.Make a safe USB powered test tube light. (optional 3D printed end).mhwbIxa2CRU.mkv | 97M |
| 20200521.Inside a TM623 astronomical time switch. (self adjusting to season).W9MTzDJtlfs.mkv | 60M |
| 20200523.Lock picking an outside tap faucet and taking it to bits..nnXIDkI8-fg.mkv | 19M |
| 20200525.Reflow attempt 2 on a custom LED art PCB (with resist)..X4d-Nk955JE.mkv | 39M |
| 20200527.Inside an airline cold-plasma ozone generator cold-plasma tube..yfmWGl1DRWI.mkv | 52M |
| 20200530.USB laundry machine for tiny (moist) Chinese panties..ugVRY-Cv7Ng.mkv | 65M |
| 20200601.Inside a nasty high voltage ozone generator PSU. (with schematic).7GpsJN3P7vE.mkv | 44M |
| 20200603.Teardown of a British electric shower that went bang..AlU69Y6NcxQ.mkv | 40M |
| 20200605.Testing UV-cure resin with glow in the dark pigment..GXO0xJL-nUA.mkv | 31M |
| 20200607.Rechargeable torch with dangerous charger (with schematics).K_9B6LapGc0.mkv | 61M |
| 20200609.Hacking fake UVC germicidal LED lamps..EwL51EGhza0.mkv | 32M |
| 20200609.Trimming a full beard to the perfect long goatee fast..Wun8Gk1hRRk.mkv | 7.8M |
| 20200611.Hacking a cheap disco light to fire UV beams..j_blpwck_hM.mkv | 74M |
| 20200612.A message from Minge the Merciless..T9Ckb_Qa8Qw.mkv | 1.9M |
| 20200614.This USB bottle generates surface sanitiser from water and salt..R5kcER2Z4-8.mkv | 50M |
| 20200617.Making cheap solar garden lights more interesting. (Laid back video.).0qqOp-luplo.mkv | 111M |
| 20200619.Hacking and overclocking a BMW 'ioniser'. (Not recommended).WDR9ojz0e5k.mkv | 67M |
| 20200621.The new blue chaos PCB..H1k7mxhWQ5Q.mkv | 43M |
| 20200623.Solid state USB rechargeable air freshener..Xa0QCaJa4lU.mkv | 44M |
| 20200625.This energy monitor plug is actually really smart inside..fRGKilvExMo.mkv | 65M |
| 20200627.Worst head torch ever. Setting a new (low) standard..84_vXw2R_5c.mkv | 10M |
| 20200629.Inside a Znter lithium 9V battery..dR_RusM99no.mkv | 43M |
| 20200702.Inside the new 2020 Airwick unit. (With 1 Volt microcontroller!).4OC4U6FiJus.mkv | 44M |
| 20200703.Inside an 'LED small lamp'..xHUWTKmQZB0.mkv | 28M |
| 20200705.Japanese fog-stick teardown..QQAptltRaXI.mkv | 83M |
| 20200706.What's the story with the jpdylon channel Live stream..NgbcEmmcBCY.mkv | 153M |
| 20200707.Exploring a popular Japanese air purifier..re4F-_FGFvI.mkv | 87M |
| 20200709.Inside an autonomous drone. (With beard entanglement incident.).WvvBm5gZoy4.mkv | 44M |
| 20200713.Exploring a solar rotating crystal orb.._WOcviOnwbI.mkv | 37M |
| 20200715.How big can we make Ralfy's remote control.z7gjQ3OUoIg.mkv | 69M |
| 20200717.Nice machining. Shame about the 'tronics. (Good base for a sci-fi prop.).1khXQahaaXI.mkv | 33M |
| 20200719.120_240V directly powered RGB LED neon strip with remote control..7fsa7WH1ajU.mkv | 71M |
| 20200721.Inside a neon tube test antenna - and electronic jammer (with schematic).xwCzqg3geIY.mkv | 59M |
| 20200723.How to make and apply a simple beard oil..BiEFzjd0YZw.mkv | 18M |
| 20200723.Sausage roll versus 250V..JBEEgkuowH4.mkv | 14M |
| 20200725.Building a USB powered PIR_Radar adaptor for LED strings..cL4h2gNFJeY.mkv | 50M |
| 20200727.My high voltage pink ring has malfunctioned (schematic and hack).cvXWr8FV51s.mkv | 68M |
| 20200729.JUGEE battery teardown. The short version..rncOmGKe4Bc.mkv | 9.4M |
| 20200729.JUGEE battery teardown full size video..dakm4ra8Xv0.mkv | 83M |
| 20200731.New improved 248V sausage roll zapping..Ekjt_HuLD9w.mkv | 11M |
| 20200803.Inside an aroma machine..lw8XwkQDv1Y.mkv | 27M |
| 20200805.The circuitry of an illuminated skip cap..Ix_slEKAtuw.mkv | 16M |
| 20200806.Cooking a hot dog with 240V food-o-cutor forks (shock risk).RmZGwEPt1ck.mkv | 7.2M |
| 20200809.Disco-Shart 4. 110V to 250V global version..jgaCYRc1-og.mkv | 64M |
| 20200811.New sign PCB files now up..4DaAJjMR1Mg.mkv | 28M |
| 20200813.Total teardown of a shady eBay light with 'mystery earth'._j488P4Lhz4.mkv | 63M |
| 20200815.Minimalist flame effect solar light (with schematic).tWUz7Yg0Z_g.mkv | 31M |
| 20200817.Inside a wearable ozone meter with alarm..8uKj_eERIP8.mkv | 74M |
| 20200819.Inside a clever Honeywell boiler wiring centre and a 3-way valve..lEOLyv5VcFM.mkv | 58M |
| 20200822.Fixing a colloidal silver unit and making a slightly dangerous one..ZAuX2WRLOVg.mkv | 57M |
| 20200823.Inside a car_room fogging disinfection unit (with schematic).9b-JkvC_SF0.mkv | 53M |
| 20200825.Poundland USB versus lightning (The lightning won.).12tqhkphNps.mkv | 24M |
| 20200827.Inside a clever USB air pump teardown with hack.7l1we5gorRM.mkv | 41M |
| 20200829.Dutch Rookworst smoked sausage versus 240 Volts (shock hazard).a5qDoQv_wog.mkv | 10M |
| 20200901.A look at an official Fog-It fogger..RI6Hh9so3bE.mkv | 39M |
| 20200904.Inside a tungsten moonflower disco light..IEvNY-b9KHI.mkv | 39M |
| 20200905.Jägermeister vs Sodastream. Will it carbonate.pJeFMIeIPhM.mkv | 11M |
| 20200907.Inside an electronic halogen lamp driver, with schematic.rsYcjysPHwM.mkv | 39M |
| 20200909.Inside an automatic foam soap dispenser with clever pump..Y8RCrJ5w5Qk.mkv | 34M |
| 20200912.MRE-Star pinto bean stew with ham - taste test..SYvuswNrJkQ.mkv | 39M |
| 20200913.WiFi wall socket teardown..tOEygVydZzM.mkv | 66M |
| 20200915.Inside a hazer phaser..ZOUeud_nHfU.mkv | 41M |
| 20200917.Underfloor heating control system teardown (with schematic).sswKeKXCnIo.mkv | 44M |
| 20200920.British neon night light and the curse of the box-tickers.On0mhPqXiw8.mkv | 20M |
| 20200922.Was this RCD damaged by overcurrent.9wcPw5hUNpQ.mkv | 56M |
| 20200924.Inside a totally smoked circuit breaker. What went wrong.jRpj70f_vLc.mkv | 32M |
| 20200924.Will Tesla's tabless cells ever use Schoopage.mYP1sIuOKGY.mkv | 23M |
| 20200926.Baileys Irish Cream vs Sodastream. Will it carbonate.6oUJ27q0noU.mkv | 9.0M |
| 20200926.Cheapest way to learn to solder.zOzXkt_PL28.mkv | 61M |
| 20200928.DO NOT OPEN! - (Challenge accepted).uPuvhnIoz2g.mkv | 37M |
| 20200930.Inside a wax motor that I cut in half..B1SScrdAq3g.mkv | 23M |
| 20201002.Aunty's spotted dick versus 240V.T-abjOrN0wA.mkv | 16M |
| 20201004.Inside a USB rechargeable misting unit (with schematic).Fy64KeeMUms.mkv | 35M |
| 20201006.Making my PSU cables literally 20 times better (0.6 to 0.03ohms).McXkzYsules.mkv | 58M |
| 20201008.Inside a car clock-spring module (steering wheel wiring interface).IK06vAlQpOs.mkv | 52M |
| 20201011.Inside a good rechargeable baseball cap work light (with schematic).rFwLp7kwvWI.mkv | 44M |
| 20201013.Acoustic foam test..bjjC5q6HOJc.mkv | 17M |
| 20201015.500V to 12V 3A power supply (with schematic).hIS8eT6NhQ8.mkv | 90M |
| 20201018.Zapping a Scotch Egg with 245V.49Dg3ohnSK4.mkv | 11M |
| 20201020.There's not much inside TVs these days.r2GX2TXwAO8.mkv | 29M |
| 20201022.Scoping a perpetual motion ornament.VcoC9nYBVpU.mkv | 38M |
| 20201024.Independent Blackview BV9900 Pro 4-month review (non shill)..X5n7oE2K__4.mkv | 59M |
| 20201026.Opening a desiccant drum dehumidifier..BUJqUapiNEc.mkv | 33M |
| 20201028.Fixing a head torch with intermittent switch..o4S53phNhck.mkv | 37M |
| 20201030.Exploring an unusual prototype cockroach zapper..naNpzv3h5fA.mkv | 57M |
| 20201102.Inside a USB rechargeable atomizer gun (with schematic).16SQ8h1RWOc.mkv | 49M |
| 20201104.Scavenging Poundland LED COBs and a hack.1TR1tom8N-E.mkv | 38M |
| 20201106.Red wine vs Sodastream. (Without repainting your ceiling.).9S7z-Lg39KM.mkv | 11M |
| 20201110.Inside an eBay 'IP65' LED wall light with barn doors for light control.cndh8bhCi-k.mkv | 50M |
| 20201112.Teardown of a vintage Lucido 20 year old LED torch..cxxPEa_N-Ic.mkv | 27M |
| 20201114.Automatic creamy schmoo-pump for splooshing foam onto your hands.f7JpP55-gIc.mkv | 33M |
| 20201115.Advocaat vs Sodastream - will it carbonate.YYm4PbHvN4s.mkv | 11M |
| 20201115.Buckfast vs Sodastream. Will it carbonate.WRwrcL1bUdY.mkv | 13M |
| 20201118.Exploring the wiring loom of a Chinese quad _ scooter..m3qycMe5Gr4.mkv | 114M |
| 20201120.Chinese quad_scooter rectifier_regulator teardown with schematic.8hvxjDa1OQ8.mkv | 23M |
| 20201122.Inside a cheap CDI Capacitive Discharge Ignition module - with schematic.R1wrrsb3RDk.mkv | 24M |
| 20201124.Inside one of the first electronic games..3ss-1cu5gtA.mkv | 36M |
| 20201126.Failed Rolec breaker from Artisan Electrics.4HQ7XOVNabg.mkv | 54M |
| 20201128.Inside a vintage Mountain Breeze Computer Ioniser..I5_OssdBRBc.mkv | 56M |
| 20201130.Inside a common eBay lithium cell charger - with schematic.stg9RkuZVPw.mkv | 21M |
| 20201202.High power ozone generator teardown with schematic._VSmWxC14JY.mkv | 71M |
| 20201204.Converting USB stars to 12V in eight colours..6vtVAgPi6Mk.mkv | 37M |
| 20201206.Xmas light frame build Diresta-style.2flsFpv92bc.mkv | 9.3M |
| 20201208.Random stuff on my bench..1WFHvS92DbU.mkv | 62M |
| 20201210.Inside a cheap set of eBay digital calipers.fKSSY1gzCEs.mkv | 64M |
| 20201212.Poundland's PIR LED tape. Worth buying just for the sensor..yVdsiXrCBlw.mkv | 40M |
| 20201214.Plastic consumer unit fire autopsy..buiJTq-w2fY.mkv | 62M |
| 20201216.Inside a Chinese fridge sanitising module (with schematic).kutNgCsJ2Hs.mkv | 34M |
| 20201218.2020 Isle of Man Christmas tractor run (Ramsey).BECRkX0zJGg.mkv | 18M |
| 20201218.More dangerous Xmas lights from eBay with fake fuse!.YtFqdPbqItY.mkv | 23M |
| 20201220.Simplest dusk sensor yet, with nice case for projects.hhQgdbEGnwc.mkv | 29M |
| 20201222.The construction and wiring of professional LED strings..YWg7jvx_mAA.mkv | 112M |
| 20201224.3D print your own lamps with free fairy light generator.1h9f0bs3C68.mkv | 36M |
| 20201224.Perfect goatee in one minute.5EMNYdRknNI.mkv | 8.2M |
| 20201225.Building the 2020 Department of Villainy Christmas display panel.Rr21GjHa5eg.mkv | 20M |
| 20201228.Inside a cheap quad_scooter starter relay solenoid.A9hVt9gMiN8.mkv | 30M |
| 20201230.Cheap laser light with amazing diffraction grating disk.3jZHEmO_w5M.mkv | 46M |
| 20210102.Lock picking and opening a quad_scooter key switch..YHfgmm7K9ME.mkv | 21M |
| 20210104.Inside a wall mounting, LED path light (with schematic).1TziZejdClw.mkv | 38M |
| 20210106.Pink and dangerous Mosquito zapper revisit.HU8_ZCg3tuE.mkv | 23M |
| 20210108.Inside a cheap eBay fridge freezer thermostat.YJg97X1VxJ0.mkv | 123M |
| 20210110.Trying to blow up a Chinese night light - and failing (with schematic).-bm-qrVRaL8.mkv | 53M |
| 20210112.The lamps you're not allowed to have. Exploring the Dubai lamps.klaJqofCsu4.mkv | 76M |
| 20210114.USA 110V fridge sanitizer reverse engineering (with schematic)._RfO-fiYDEQ.mkv | 35M |
| 20210116.Repairing an industrial beacon (with schematic).8Ys-6-skMvE.mkv | 30M |
| 20210118.Power saver plugs just got a bit darker.iy1P08aj73k.mkv | 34M |
| 20210120.Over_under voltage detector - with schematic.NX84d45ZlBM.mkv | 36M |
| 20210122.Teardown of a flush mounting feature light.oVt2BQMLCBw.mkv | 26M |
| 20210124.Dumpster-dive Honeywell 2-port valve teardown.Ufx_t81w3fE.mkv | 66M |
| 20210126.Make your own Dooby lamps - DIY Dubai lamps (strobing alert).ISTB0ThzhOY.mkv | 65M |
| 20210128.120_240V to logic level optoisolator (with schematic).0C2o0rXOXYE.mkv | 49M |
| 20210131.Inside a fake un-trippable circuit breaker..2TJEzdqtXlQ.mkv | 12M |
| 20210202.Inside a 58V E-scooter rear light.S6QnpHw76aA.mkv | 31M |
| 20210204.Troubleshooting a heating controller..tM4P39KxtyM.mkv | 32M |
| 20210207.Inside a Nokero solar light (with schematic).fQqkxwuBLcU.mkv | 63M |
| 20210208.How I get my crisp macro shots with tupper-cam.L6sAS-y21xA.mkv | 34M |
| 20210210.Incredibly clever oil furnace burner controller (very perplexing).TYhv6fgP_u4.mkv | 47M |
| 20210212.Worst fake 'power saver' plug yet.yA5G7kR_xa8.mkv | 23M |
|
|---|