![[ICO]](/icons/blank.gif) | Name | Size |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | - |
![[VID]](/icons/movie.gif) | 18 British Soldiers Blown Up In Northern Ireland [DAucSugCYJ0].mp4 | 11M |
| 40 Indian Soldiers Killed in Blast [LvvUTm3GQYk].mp4 | 8.9M |
| 50 Miners Buried Alive in Tanzania [AgfYOaNabO8].mp4 | 7.5M |
| AMERICAN MASSACRE IN IRAQ [Eq3B2KbtYAo].mp4 | 6.8M |
| AUDIO： Cop Brags About Killing 13 People [szGNreGndO4].mp4 | 1.7M |
| Al Shifa Bombing ｜ “Bill Clinton’s Act of Terrorism” [ghL4ymGQsSA].mp4 | 4.0M |
| Are You A Genocide Denier？ [1AdrhaKSUu8].mp4 | 7.1M |
| Biometric Warfare in Iraq, Afghanistan [kb5il7cPFpM].mp4 | 5.6M |
| CHEMICAL WEAPONS IN IRAQ ｜ HALABJA MASSACRE [Ss5anJ_YGB4].mp4 | 5.4M |
| Carrot Cake Oreos x Chevy Malibu [Aq4_L2K5rVM].mp4 | 9.7M |
| Chicken Katsu… [AvIlSqIkVSE].mp4 | 5.5M |
| Colombian Death Squads in One Minute [lwtOUWfJJs4].mp4 | 6.2M |
| Debunking “Ancient Israel” [sQk41nLuhGA].mp4 | 552M |
| Debunking Human Shields (Easy) [pn1uEA7acVY].mp4 | 550M |
| Debunking Israel's Defense Speedrun [FtK0IqKs6FY].mp4 | 292M |
| Did Gaddafi Give Guns to The IRA？ [7gSkzCJjBW4].mp4 | 9.4M |
| Did NATO shoot down a passenger plane？ [xaV7fLMiSyM].mp4 | 4.1M |
| Downing Street Bombed (1991) [dZqXjBVsL0Q].mp4 | 7.0M |
| Ewen cameron’s delicious eggplant parm [l7hxE6xfNLg].mp4 | 7.0M |
| Full Video Link in Description [s3TFrarhlRk].mp4 | 4.1M |
| Gaza Flotilla Massacre [1uCOzK4NNm4].mp4 | 5.3M |
| He Exposed Israel... [pnOM7wMkUww].mp4 | 10M |
| Homemade IRA Weapons [gVuDrBYZrpE].mp4 | 8.7M |
| How America Turned Afghanistan into a Narco State [l1TL3BLU23U].mp4 | 6.3M |
| How Bad is Kashmir？ [fMwbufPGr0g].mp4 | 9.9M |
| How Ethnic Cleansing Created Israel [e9To_P8gX9c].mp4 | 716M |
| How Ford Funded Death Squads in Argentina [nHjKKSk-1rM].mp4 | 143M |
| How Haiti Got So Good At Smoking French Soldiers [x5SvKuXfRas].mp4 | 648M |
| How Henry Kissinger Killed 3 Million People [Fa7VGxMYcd8].mp4 | 229M |
| How Iraqis Got So Good At Smoking American Soldiers [bKLFUMrNDpQ].mp4 | 358M |
| How Israel Cucked the United States [CfABflKvFzk].mp4 | 521M |
| How Israel Lies About Literally Everything [7eHQKJTnBoY].mp4 | 169M |
| How Israel Merked its Own Civilians on October 7 [fCjTki-OgKQ].mp4 | 199M |
| How Israel Starves Palestinians [XZRWxBvzVjY].mp4 | 8.4M |
| How Kashmiris Got So Good At Smoking Indian Soldiers [cvhddK3tWNY].mp4 | 604M |
| How The Irish Got So Good At Smoking British Soldiers [TcRh0b9obDU].mp4 | 517M |
| How The Lebanese Got So Good At Smoking American Soldiers [480ILf6LkIc].mp4 | 416M |
| How US Drones Kill People [hN_1WNH2Kr4].mp4 | 7.3M |
| How the CIA Discovered Israel's Nuclear Weapons [QNI7_u99rec].mp4 | 356M |
| How the Viet Cong Smoked American Soldiers [cDk8Fo8ss8M].mp4 | 447M |
| Hurricane Katrina ｜ Man Made Horrors Beyond Comprehension [kfW015e1Ew0].mp4 | 4.9M |
| IRAQIS HANG AMERICANS FROM BRIDGE [UYroHf0vJf0].mp4 | 10M |
| In-N-Out Burger X Vietnam War Free Fire Zones [8AJWGduiOYM].mp4 | 8.3M |
| Iraqi Food x The deadly Iraq Sanctions [qSMBRgOlP7A].mp4 | 6.9M |
| I read an antisemitic book... [FHPi4cTrosw].mp4 | 200M |
| It's official. [s7RFKXSyjvo].mp4 | 161M |
| Korean War Biological Weapons [XtDGJYS8TP4].mp4 | 5.0M |
| Let's say, hypothetically, war with Iran [_p8AbplXQF4].mp4 | 491M |
| Meet Israel's New Fascist Government [uy2Ca5q9yKM].mp4 | 199M |
| NATO is Risking Nuclear War for Money [0WbNiI4bQkU].mp4 | 321M |
| No, We Didn't Need to Nuke Japan [u3pTh6AMpvs].mp4 | 273M |
| Peeing Like This Could Get You Killed By A Drone Strike [srvoSps87JA].mp4 | 289M |
| Piers Morgan is Wrong [tRuKM5-WcGo].mp4 | 389M |
| Predatory Lending in Black Neighborhoods [m_PaKrYz-3c].mp4 | 5.5M |
| Saudi Arabia Is Slaughtering Hundreds of Civilians Right Now [RsLwaauLCfo].mp4 | 299M |
| Spicy Chicken x Chemical Warfare [eCz3Cjp_1HA].mp4 | 11M |
| Sunday dinner with a side of history [rllngyK38Dw].mp4 | 8.8M |
| Sure, Hamas are Nazis [ywMFnGU03Fw].mp4 | 453M |
| THE NSA SPIES ON YOU (Yes, YOU!) [6n0uFMotgjA].mp4 | 55M |
| Thatcher Was (Almost) Assassinated [BBt_gtR2UZE].mp4 | 8.3M |
| The American Journalist Murdered in Chile [genBXs5OJX0].mp4 | 4.3M |
| The Bombing of Laos [pta_AkIbRko].mp4 | 7.7M |
| The Conflict Based on a Lie [dy56Q1a0Flc].mp4 | 288M |
| The Day Democrats Destroyed The Economy [u-uOqPJNrx0].mp4 | 200M |
| The Evils of Johnson & Johnson [-ltCON0X3D4].mp4 | 4.9M |
| The IRA’s Most Brutal Assassination [ON9gI8HDP-A].mp4 | 6.3M |
| The Iraq War Wasn't About Oil [zeloY3bVBtc].mp4 | 608M |
| The Irish War for Independence [rqijoR3Cb3U].mp4 | 5.0M |
| The McGill Sensory Deprivation Experiments [HHAjhuUvT-c].mp4 | 6.4M |
| The Most Important Economics Video You'll Ever See [UFvracb4kms].mp4 | 283M |
| The Philippines Dictatorship ｜ 1965-1986 [eDoWB3_mxb0].mp4 | 5.6M |
| The Serial Killer Who Worked for the US Government ｜ The Story of Dan Mitrione [pFYcqeIxIac].mp4 | 67M |
| The Unreleased CIA Sex Tape [gARszycpW1E].mp4 | 4.3M |
| The War Based On A Lie... [DSi_KA-cmRA].mp4 | 11M |
| There Was No ＂Cold＂ War [e-Tgv-ABoZ4].mp4 | 392M |
| There Was a Genocide in Korea and Nobody Cares. [sFMUPVAEaQE].mp4 | 100M |
| These Countries Have US-Trained Death Squads... [DmSu8Tjv1cc].mp4 | 199M |
| Tiktok Feta Pasta X Indonesian Genocide [jm_cDrJg18A].mp4 | 7.6M |
| Timorese Genocide [A80VPdRVThU].mp4 | 5.9M |
| Tyson Chicken Workers Forced to Wear Diapers [DMqag0Knx4E].mp4 | 5.8M |
| US Admits to Using Napalm in Iraq [h7UhvJg7o2Y].mp4 | 4.3M |
| UVALDE FOOTAGE RELEASED [CX7UvR0Zlqk].mp4 | 5.4M |
| Uber’s Illegal Activity [frRlrYlAGLU].mp4 | 5.0M |
| Vietnam War Mines and Booby Traps [Kg4XAgxj74s].mp4 | 8.8M |
| Vietnam War Trophies ｜ Ears, Scalps, Teeth, Genitals [wS1URk8-6cg].mp4 | 4.9M |
| Wait for it... [rKrFg3V-OPg].mp4 | 12M |
| What If The US Brought Back The Draft？ [-zmbmi8rQkw].mp4 | 4.3M |
| What They Don’t Tell You About The Iraq War [__WOXCc9zCE].mp4 | 388M |
| When American Soldiers Smoked American Soldiers [0n_QAFUSbRQ].mp4 | 350M |
| When The CIA Car-Bombed a Neighborhood [YvD-vprFEp0].mp4 | 71M |
| When the US Kidnapped a President in 2004 [IjbYXYgqEnI].mp4 | 6.3M |
| Who REALLY Controls US Foreign Policy？ [YZdpIRMZoSw].mp4 | 567M |
| Why Does North Korea Hate The US？ [bDuP-obCqDQ].mp4 | 7.5M |
| Why Does North Korea Hate the US？ [fE9MUwAbFQI].mp4 | 74M |
| Why Does The World Not Care About Arabs？ [MGZVu96oVnA].mp4 | 6.2M |
| Why Israel Deliberately Targets Civilians [QraCgxStVcQ].mp4 | 246M |
| Why Israel Kills So Many Civilians [6S-Q07ow7xc].mp4 | 105M |
| Yes, Amy Schumer, Israel is an Apartheid State [jBHAitSKtVs].mp4 | 535M |
| Yes, Israel is Committing Genocide [AF-FoC0lWvM].mp4 | 260M |
| You're Arguing With An Israeli Bot [KJq_jHGMy8A].mp4 | 9.0M |
|
|---|