![[ICO]](/icons/blank.gif) | Name | Size |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | - |
![[VID]](/icons/movie.gif) | 20140921.Peppa Pig listens to a Certified Hood Classic.tSFuffv2RTw.mkv | 1.4M |
| 20140922.The New Apple Watch.eSoZxxr2sxk.mkv | 503K |
| 20141006.My First Montage parody [Cancer Warning].gbLPYUWit8A.mkv | 3.0M |
| 20141023.xX_X-men_Xx (Unfinished).u9WvV-UOYhM.mkv | 1.6M |
| 20141220.get rekt.KXpDMEIZi7k.mkv | 359K |
| 20141223.Skrillex Playing my Crash Bandicoot Remix Live.-ORZbZG0FOs.mkv | 2.0M |
| 20150104.shout out to all the pear.QAvzCYPPwu8.mkv | 751K |
| 20150107.Evolution EP.U0jBdqILxI8.mkv | 2.5M |
| 20150114.Mt. Dew Before vs. After.QLovyAjrKpk.mkv | 615K |
| 20150218.DISRESPECT YOUR SURROUNDINGS.sBsyMDVurSo.mkv | 562K |
| 20150601.chasingaduckwithamountaindewbottle.mp4.o7clopcm60Y.mkv | 376K |
| 20150711.PREGNANT MINION GIRL SPEEDRUN (WORLD RECORD).USrKvC930Ko.mkv | 1.6M |
| 20150721.Masterchef - Minion edition.U4zw6bXqAis.mkv | 508K |
| 20150810.I'm not an Albatroaz.oyfJJdQ3C9Y.mkv | 1.3M |
| 20150915.Minions are Cancer.XN8EdIRiHro.mkv | 1.4M |
| 20160401.mlg teletubbies 2.LezZkOpCyxc.mkv | 6.2M |
| 20160503.NFKRZ - DAB.Mffe8oO511k.mkv | 8.3M |
| 20160512.KEEMSTAR IS A WEEABOO.LSQiX2syKE0.mkv | 1.0M |
| 20160515.Colossal Is Crazy - ROAST DUCK (LYRIC VIDEO).sbPT0n8JlDY.mkv | 1.0M |
| 20160523.Grand Theft Auto IV - Keemstar Edition._7ZiYA8riZc.mkv | 1.6M |
| 20160528.Keemstar - To Be Continued.HvpxQh1pA1c.mkv | 788K |
| 20160528.Keemstar - To Be Continued 2.QIycSVcbS0s.mkv | 431K |
| 20160604.KEEMSTAR VS DOLAN DARK - #UnblockDolanDark.bPkgJOYaYa0.mkv | 3.4M |
| 20160605.To Be Continued - Keemstar & iDubbbz.FkHyhDQNmKg.mkv | 694K |
| 20160610.That Special kind of Cancer.qVYs3AymuvE.mkv | 1.2M |
| 20160611.I'm...R_w9aInG4uM.mkv | 1.2M |
| 20160612.HAVE MEMES GONE TOO FAR.1Kd8M7kWj3w.mkv | 1.2M |
| 20160612.When Ducks Attack.C9oVVBKiWnY.mkv | 786K |
| 20160618.30 DUCKS OF DOOM!!!!!.Y3G7KATpkfo.mkv | 619K |
| 20160619.Fast as fuck boi.xBdKARLzMBA.mkv | 1.2M |
| 20160622.i know music better than any of you.gq8A2Eh_8RY.mkv | 3.3M |
| 20160625.The Leap of Faith.WD6zeo2SGBc.mkv | 1.1M |
| 20160625.real doggo hours.JKVf6P3mp4M.mkv | 784K |
| 20160626.Not all heroes wear capes.lRqPD86ASlU.mkv | 914K |
| 20160710.Taking out the Trash.DUH5YE8FGV0.mkv | 1.5M |
| 20160712.REAL GOTH HOURS.hpJwhYiWlMA.mkv | 2.0M |
| 20160712.THE FATTEST BONG RIP EVER.Z2KDO2U05WA.mkv | 1.7M |
| 20160720.Proud To Be.6dc5xXh7oB0.mkv | 448K |
| 20160724.Jump down and say some gay shit.JFJxVqpS4Lg.mkv | 400K |
| 20160803.KEEMSTAR VS DOLAN DARK - Keemstar's Revenge.ytswx1lbZXU.mkv | 5.5M |
| 20160818.Bubble Upload.PbKnGSjpUwY.mkv | 872K |
| 20160818.Something you might like to hear.v7dNN2aA_rY.mkv | 819K |
| 20160819.Peekaboo.7yd9BQMZOEM.mkv | 287K |
| 20160821.The Stuff of Nightmares.iS72w3wvmdg.mkv | 522K |
| 20160823.JOHNNY IS HERE.tZa3_4LGTmE.mkv | 372K |
| 20160823.John Scarce.1jPNXYROD3I.mkv | 446K |
| 20160829.hey what's up guys it's scarce here.6C6zVnGtuFg.mkv | 477K |
| 20160905.Harry and Dubledore.UppDCmQhBOU.mkv | 513K |
| 20160906.Hey whats up guys, Scar here.H7aplxeNcBY.mkv | 707K |
| 20160909.CODE - DUCK.rJ85TNlgBxg.mkv | 822K |
| 20160909.What is going on inside their head.1zPrL95uMNk.mkv | 524K |
| 20160910.WE REALLY OUT HERE.qhuQvc_9vcU.mkv | 952K |
| 20161006.PPAP Pen Pineapple Apple Pen - Youtube Meme Edition.U6QzAYo5gqo.mkv | 2.2M |
| 20161011.The Real LeafyIsHere EXPOSED.n30jn8-pqPo.mkv | 1.8M |
| 20161012.I WAS FINALLY ON DRAMA ALERT.V3gYDMBHfQ8.mkv | 1.4M |
| 20161019.hey what's up guys it's Scarce Memes Compilation here.lsv2sqergcw.mkv | 2.6M |
| 20161023.Colossal Is Crazy VS FouseyTube.9GTpHVxlF7o.mkv | 2.8M |
| 20161101.I Prefer Chicken.SKtnmFt5C20.mkv | 1.3M |
| 20161104.KEEMSTAR VS DOLAN DARK - Education Sucks.6gmSR1PdhOU.mkv | 2.0M |
| 20161109.Election Meme.F9hGgHaVofQ.mkv | 1.5M |
| 20161208.THE REAL Youtube Rewind 2016.FdGkolCSLU0.mkv | 1.7M |
| 20161212.THESE GLASSES CURED HIS COLORBLINDNESS!.sz2MYHeWywU.mkv | 2.0M |
| 20161219.Youtube Subscriber Glitch.043Liz6EkqE.mkv | 1.3M |
| 20161220.MTV's 2017 New Years Resolutions for White Guys, but every time someone says something stupi.4B3MZfrehFM.mkv | 522K |
| 20170107.Whats 9 + 10.-0GGUZ1hy54.mkv | 242K |
| 20170113.I'M GOING TO UNLEASH MY SECRET WEAPON.Fkk3BgLkFa8.mkv | 1.3M |
| 20170117.What is the Ideal Size.7bIK7cuyTgw.mkv | 560K |
| 20170119.If you're Patrick, then who's that.9BqrD7iihMc.mkv | 827K |
| 20170120.Man finds Amazing Hidden Treasure.-ECYs6ueXyE.mkv | 2.9M |
| 20170122.Dank Memes Compilation 2017 NEW.BUtFYyieHIk.mkv | 5.7M |
| 20170125.Do 2 Dead Memes = 1 New Meme.Y7jbMzXwn90.mkv | 387K |
| 20170126.iDubbbz VS Tana Mongeau Meme.HxA31S6HYxw.mkv | 1.5M |
| 20170127.iDubbbz VS Tana Mongeau - Youtube Friendly Edition.10dYhWzWw7c.mkv | 2.2M |
| 20170130.Fiverr is the greatest creation known to man.rPK-urRa6qE.mkv | 4.1M |
| 20170201.Club Penguin Music Video - Roast Duck.W-udgp6zthI.mkv | 2.6M |
| 20170202.President Trump has an important annoucement.ZyjCXFjFUFc.mkv | 1.8M |
| 20170205.Old Memes - The Movie.uMTtaR6HbDU.mkv | 1.9M |
| 20170206.The Toothbrush Challenge.uqz7mgiBXO0.mkv | 676K |
| 20170209.Selling Out - Fiverr Edition.FQsyGvGw-mE.mkv | 5.1M |
| 20170213.The Eye.0K-4Dj38cWw.mkv | 1.0M |
| 20170214.Hitler Reacts to the Pewdiepie Controversy.VzqLEuqxul4.mkv | 6.6M |
| 20170216.A Scarce Phone Call.xBb0-JWEzjQ.mkv | 425K |
| 20170219.Hey Vsauce, Michael here - Shooting Stars Meme.dsPF8SPAy7E.mkv | 2.8M |
| 20170222.You can't escape the Memes.AJtmsaiOXps.mkv | 1.4M |
| 20170223.Hey Guys, Shooting Scarce Here.yEH6CxPverM.mkv | 921K |
| 20170226.Shooting Stars Meme - Royalty Free.KNgC30Vt55U.mkv | 3.3M |
| 20170227.The Oscars Announce the Wrong Winner AGAIN.6tGv3E0G1XE.mkv | 1.1M |
| 20170228.Memes Compilation.rzOI0ZvEhkk.mkv | 14M |
| 20170305.Monkey puts on an Amazing Song.oGTZ4HFko6s.mkv | 2.2M |
| 20170306.Selling Out - GONE LEWD.tVQaphHFVt0.mkv | 2.5M |
| 20170307.Spooky Meme.hEX4MKhfRsE.mkv | 1.6M |
| 20170310.Arrival of the Memes.DRlO4ezlKXI.mkv | 1.2M |
| 20170312.Gary Oak's New Pokemon.XDQQdSe5iGw.mkv | 658K |
| 20170315.Donkey Discovers Old Memes.uPyi7lNbqms.mkv | 1.3M |
| 20170317.Creating the Perfect Meme.l9yYOSgnnIM.mkv | 2.1M |
| 20170320.Nuclear Explosion VS. Fridge.uKpOCbkzPOI.mkv | 1.9M |
| 20170322.Wolverine Meme.XsmDw8qrZ2E.mkv | 1.4M |
| 20170325.Hot and Steamy Meme.ZSywyjQyn58.mkv | 565K |
| 20170327.Mirrors Don't Lie.2133ZH6TE3g.mkv | 1.4M |
| 20170328.iDubbbz reference in Iron Fist.bmyLNlCT2pQ.mkv | 1.8M |
| 20170330.Club Penguin Final Moments.Sd5VxKFO474.mkv | 7.7M |
| 20170331.IT Meme.UVsz4AickXw.mkv | 1.7M |
| 20170401.Welcome to my Mine.RR193lwrjl4.mkv | 2.8M |
| 20170402.I didn't know there was this much green in the whole galaxy.gQLHsoNQetw.mkv | 801K |
| 20170403.Another IT Meme (HIT).FgiI-JVdVvc.mkv | 1.7M |
| 20170404.Whats in the Box.5Nar2xRQIFU.mkv | 1.4M |
| 20170406.I have.dB0stxGS4qU.mkv | 668K |
| 20170408.Introducing Google NO.QtQ19tqI8b8.mkv | 4.1M |
| 20170410.Hey Vsauce, Michael head.c0P3o2pa_6M.mkv | 653K |
| 20170412.United Airlines Meme.MlYsm8PPiRA.mkv | 2.8M |
| 20170414.I didn't know there was this much green in the whole galaxy again.etIkpIbzU4g.mkv | 759K |
| 20170417.Batman Meme.Yyi_p4c013M.mkv | 1.5M |
| 20170419.This is the new Google Earth.x-ptJgnOcDg.mkv | 2.1M |
| 20170422.DO NOT CALL THIS NUMBER AT 3_00 AM!.XmwFCpsaE7Y.mkv | 1.6M |
| 20170423.Humanity's Biggest Fear.NghF4a58YI0.mkv | 1.5M |
| 20170425.Man Finds Secret Tape.mJmCKjmHL0k.mkv | 955K |
| 20170427.Humanity's Biggest Fear Yet.e_l0277Yng4.mkv | 1.0M |
| 20170430.Play This at my Funeral.XMLx3n49aWM.mkv | 1.5M |
| 20170503.Stephen Hawking gets a New Voice.9OKvqAHYpWk.mkv | 1.6M |
| 20170504.You Wouldn't Make a Star Wars Meme.6hdymh1_Ev0.mkv | 1.9M |
| 20170507.The Amazing Squeaking Frog.9DZG2Q6Xj4M.mkv | 2.1M |
| 20170508.Theres a Clown in the Sewer.2UWugp_tdXA.mkv | 1.3M |
| 20170510.When I'm Meme.E7KAUT3txWc.mkv | 2.1M |
| 20170512.The Ideal Size.vIsKnkPRgKE.mkv | 736K |
| 20170513.The worst sound imaginable.jVP8mplW6Rc.mkv | 1.4M |
| 20170515.Take on Meme.r2y37E2cNd0.mkv | 1.7M |
| 20170516.Whats in the Closet.sY_o2z0ScPE.mkv | 1.9M |
| 20170517.Another Spooky Meme.LEK0mASdO3I.mkv | 1.0M |
| 20170519.Durv Meme.6xP7zVP7Gik.mkv | 1.5M |
| 20170520.The magical swimming pool.vJR6wZKF0NE.mkv | 1.6M |
| 20170522.the most powerful sound system in the world.EOgW_12S1RQ.mkv | 2.4M |
| 20170524.I'll See You Again.E4_Pd1kDojA.mkv | 665K |
| 20170525.The Emoji Movie trailer but its blatant Self Promotion._I1wugEiYUs.mkv | 4.7M |
| 20170526.What's under Darth Vader's mask.kpZWfLLpw98.mkv | 910K |
| 20170528.How to Send an Online Message.EqmNHyVkYTE.mkv | 1.3M |
| 20170529.Becoming a Pokemon Master (MaxmoefoePokemon Meme).QxEyRPnjfzI.mkv | 2.0M |
| 20170530.Bane's incredible speech.a0OsgA7A_x0.mkv | 1.0M |
| 20170531.the secret behind covfefe.eiYW0BWQTFU.mkv | 2.1M |
| 20170601.Guardians of the Meme.SZlFe2ChYVY.mkv | 1.3M |
| 20170602.The Meme Analyzer (Jake Paul - It's Everyday Bro).vrPgY-NLz6A.mkv | 869K |
| 20170604.How Durv Got Suspended.rjDsQiYG9P4.mkv | 1.9M |
| 20170605.this is what happens when you insult Jake Paul fans.yyj9A3ed0bk.mkv | 1.9M |
| 20170606.Fifty Shades of Meme.cUkVBwNy-i0.mkv | 1.1M |
| 20170608.Robots Meme.OUNqHV5uQ7s.mkv | 856K |
| 20170609.How to use a Megaphone.qiKIEKTXANo.mkv | 2.1M |
| 20170610.Jake Paul performs an IMPROVED version of 'It's Everyday Bro'.Y8F_yTl1itY.mkv | 3.6M |
| 20170611.The greatest musical scene in history.GxylUVsnT6c.mkv | 1.9M |
| 20170612.THE TRUTH BEHIND LANCE STEWART GHOST VIDEOS.h3v2dt4WBZA.mkv | 1.8M |
| 20170613.Minecraft gets a brand NEW upgrade.IRWCvhKrgqg.mkv | 1.7M |
| 20170614.amazing invention helps woman with parkinson's write again.oaUKM3PiIKk.mkv | 1.1M |
| 20170615.The Biggest Surprise at E3.Bik_ULmFLGg.mkv | 1.2M |
| 20170616.Anime is finally REAL.8CiuNMb24K0.mkv | 2.0M |
| 20170617.LANCE STEWART CALLS A GHOST.QNcUz_2VK_g.mkv | 1.3M |
| 20170618.Where is Scarce.yPmoqFUVf54.mkv | 3.4M |
| 20170619.Be careful who you talk to online....BiJcvPj9LJM.mkv | 1.5M |
| 20170620.Don't Open the Door!.BOWAGRsLTmU.mkv | 949K |
| 20170621.I do not like my YouTube comments section.DH16uxHdFwo.mkv | 1.9M |
| 20170622.When you watch too many memes.3SBQtMAVML0.mkv | 1.7M |
| 20170623.The Perfect Mutant.0Qd7cT3gyrI.mkv | 1.3M |
| 20170624.The Biggest Ego in the World (Christian Burns).dJYU7gx3MEg.mkv | 2.4M |
| 20170625.The Biggest Ego in the World - The Conclusion.adrAvN8kytI.mkv | 2.3M |
| 20170626.The Perfect Sound.UO2sYTkFB0k.mkv | 1.8M |
| 20170628.then who was flickering the lights.zUerg0IrBsA.mkv | 537K |
| 20170630.Deleted Toy Story Scene.yg-MFXf0UKs.mkv | 892K |
| 20170703.I saw you on TV last night.mX31agQtNoY.mkv | 1.1M |
| 20170704.Did i hit something.osPYZ7vDMKI.mkv | 968K |
| 20170705.He will come for you..tZL4KnbLEgs.mkv | 1.6M |
| 20170706.Jake Paul copyright striked me.pLcxEbSdc2I.mkv | 2.4M |
| 20170708.The Worst Sound.BaYqu4mhuCg.mkv | 2.0M |
| 20170709.Jake Paul must be stopped.i5CO2oJs_HA.mkv | 2.7M |
| 20170710.The Perfect Driver.3RRlMHPAxkA.mkv | 1.2M |
| 20170713.your worst nightmare.nlOKqE1E12o.mkv | 1.1M |
| 20170714.XXXTENTACION's XXL Cypher but its IMPROVED.wDC2bt2y1E8.mkv | 1.7M |
| 20170715.How to use Grammar correctly.JTStyB2V_v0.mkv | 1.7M |
| 20170716.pewdiepie doesn't like me....OdsnNEaA_i8.mkv | 2.7M |
| 20170717.What Ed Sheeran's Cameo on Game of Thrones felt like.F1QtStYNPXE.mkv | 1.5M |
| 20170718.Vsauce Michael in the box.3iAGVy5iljw.mkv | 387K |
| 20170719.Introducing the NEW Doctor Who.Or0J6XwEDGA.mkv | 1.8M |
| 20170720.if JAKE PAUL was in the Hobbit.edSE_NGSJ1o.mkv | 1.2M |
| 20170722.SCARCE IS BACK.miIlkF7czTA.mkv | 2.7M |
| 20170723.Jake Paul fans are everywhere.AmwEzCCQRc4.mkv | 1.7M |
| 20170724.The Perfect Mutant 2.OaXycSA7nqQ.mkv | 1.2M |
| 20170725.The Hound sees something horrible in the flames.mFDYBiDUnGI.mkv | 1.6M |
| 20170726.I'M JAKE PAUL & YOU'RE NOT WATCHING DISNEY CHANNEL.zEpWPZlVbWE.mkv | 1.7M |
| 20170727.The perfect virtual world.mpB6vR-ApAQ.mkv | 1.8M |
| 20170729.The Emoji Movie is actually good.VBFNH5xG1MA.mkv | 2.6M |
| 20170730.The Lord of the Woah.PQRt5IyYWZc.mkv | 2.2M |
| 20170801.Introducing Amazon WOAH.uVKvgihFYlA.mkv | 2.4M |
| 20170802.Hey Vsauce, Cereal here.Kh3MctCrLgQ.mkv | 815K |
| 20170803.Introducing Youtube Echo.Yy_l92OXJZU.mkv | 3.0M |
| 20170805.Anthony Fantano doesn't like me....daNSbNhT3b0.mkv | 2.1M |
| 20170806.How to be - Jake Paul.0w3k78sdkdU.mkv | 2.4M |
| 20170807.If Youtube was part of Game of Thrones.GKh0tYp0MN8.mkv | 1.1M |
| 20170809.Keemstar meets Spotify.EVxkEzloP9k.mkv | 1.2M |
| 20170810.Valve Disappoints Thousands of People at Once.74iMex1wIUw.mkv | 1.1M |
| 20170813.I got blocked worldwide.pW1A29PTPtU.mkv | 1.9M |
| 20170815.REACTING TO KSI - LITTLE BOY TRACK REACTION.BoSjqktFUrE.mkv | 2.0M |
| 20170816.Tag, you're it!.izujGMpB8Kc.mkv | 1.8M |
| 20170817.the internet's biggest fear.G7NsRcvA31I.mkv | 1.0M |
| 20170818.what the heck.BH6JZ2L6qwM.mkv | 624K |
| 20170819.Jake Paul fans in action.-OQK9iZspYQ.mkv | 2.0M |
| 20170820.Jake Paul has really let himself go.Xeoxa68TvmE.mkv | 430K |
| 20170822.I got blocked worldwide.. again..UxvFLpLwVwE.mkv | 2.0M |
| 20170823.In my mind, I am free.BAFA4WUVd7E.mkv | 2.0M |
| 20170825.PEWDIEPIE DISS TRACK.xCt3u3KsvXE.mkv | 3.2M |
| 20170826.What are you listening to.stDDWtMGo34.mkv | 1.3M |
| 20170827.When you find out your son is a Jake Paul fan.iR68rzvlcVs.mkv | 507K |
| 20170828.Big Ben's Final Bong.tqYuhyr71ig.mkv | 1.6M |
| 20170829.The Future of Music.tNELSHAtwQM.mkv | 2.8M |
| 20170830.You'll always be my brother.LIGXVfj42Yk.mkv | 822K |
| 20170831.The NEW Youtube Logo.216xvaj_OAA.mkv | 1.1M |
| 20170902.Big Ben's Final Ting.kGoUnuSuLjY.mkv | 1.1M |
| 20170904.Rick and Morty Meme.Mab5dufbsVc.mkv | 1.4M |
| 20170905.Introducing Google Meme.tSIzOw4rtBg.mkv | 2.2M |
| 20170907.Digital Blackface._m-9XczJODU.mkv | 1.6M |
| 20170908.What the heck is that thing.jRslo1vgsh4.mkv | 2.2M |
| 20170910.The New Rapping Barbie.BqGk22bjWPY.mkv | 1.8M |
| 20170912.The Pewdiepie Situation.c2Qzx7v5VVc.mkv | 1.2M |
| 20170914.iPhone X's New Face Recognition (parody).K04jPtY2jqU.mkv | 954K |
| 20170916.How to show your son you love him in 2017.ok1OCsYGiQk.mkv | 489K |
| 20170918.Attack on Youtube.zPFe0qOmjSk.mkv | 2.2M |
| 20170919.The Perfect Flute Solo.Nm8l5qWsi2s.mkv | 1.3M |
| 20170920.ZUCC.t6YjvlSGx8M.mkv | 1.5M |
| 20170921.what the heck².QPiZCa8-dMY.mkv | 618K |
| 20170922.Morty reacts to the Rick and Morty fanbase.XKL3iTdgi5E.mkv | 1.7M |
| 20170926.Big Shaq - What is Ting.E_XYIHbPO84.mkv | 3.0M |
| 20170928.pewdiepie ruined my life.QFUIds4e6YY.mkv | 2.5M |
| 20170930.How to stop a baby from crying in 2017.6EGYYkn8Gv8.mkv | 605K |
| 20171002.never cheat on a test.Ep6HZxQ3HlU.mkv | 1.9M |
| 20171003.This should not be allowed in Minecraft.DOV0KdGeZyk.mkv | 2.3M |
| 20171004.The Ricegum Content Cop.01izVKC4x-E.mkv | 2.1M |
| 20171005.Spider-Man gets exposed.mvvLavJ7oU0.mkv | 1.7M |
| 20171011.Every time Ricegum contradicts himself in the iDubbbz Diss Track.ZKCUK2oWD3A.mkv | 3.1M |
| 20171014.iDubbbz reacts to Keemstar.Xh5holrmzus.mkv | 1.6M |
| 20171019.Beauty and the Meme.yXgveIp3Roc.mkv | 1.9M |
| 20171023.Timmy visits a naughty website.r4o1Q9OZQF0.mkv | 680K |
| 20171030.Big Shaq - Tingbumps.XgfoT8R9N88.mkv | 3.7M |
| 20171106.'S' Stands For...XZtBY48_FM0.mkv | 420K |
| 20171109.this is music.PowuVhytigs.mkv | 1.5M |
| 20171111.When you watch a Dolan Dark meme.tGZ_r1YTqGs.mkv | 1.2M |
| 20171112.Stranger Memes.owG8ngIq8xI.mkv | 1.5M |
| 20171115.Creating the Perfect Drawing.D9mWnxIUYNw.mkv | 1.5M |
| 20171117.If the Star Wars Movies were made by EA.d61W869sZjw.mkv | 2.1M |
| 20171120.Stranger Memes 2._FerqztC1Uw.mkv | 1.4M |
| 20171121.Talented young musician stuns Pharrell with her music.oWjkvhMcuwg.mkv | 1.4M |
| 20171122.THATS NOT HER DOOR.FyUfZeoMeB8.mkv | 965K |
| 20171123.Shrek Enough.PhGGTjIaSYQ.mkv | 1.2M |
| 20171125.net neutrality._6Jn0QOXZNA.mkv | 178K |
| 20171129.Creating The Perfect Image.O0q4Zf3B1nE.mkv | 1.5M |
| 20171201.You wanna Sprite.YmtHpd9eg1U.mkv | 711K |
| 20171202.The Avengers - Meme War.6IAaBf1JOfQ.mkv | 2.1M |
| 20171204.reacting to Jake Paul's terrible new christmas song.RgeJ-d0aIew.mkv | 2.9M |
| 20171205.Amazon Echo Memes.RpJfqpDteVw.mkv | 1.4M |
| 20171206.this anime scene will shock you.L84nZGtg084.mkv | 1.4M |
| 20171208.Samuel L. Jackson sees something scary.RrWCLWAYMAw.mkv | 752K |
| 20171210.Alex Jones meets Alexa Jones.w4_JYSAPz3Y.mkv | 2.6M |
| 20171213.The power of Patriarchy.8yLicMjKagc.mkv | 546K |
| 20171216.Ajit Pai ends Net Neutrality.o3i94oaQw5M.mkv | 1.7M |
| 20171217.Vsauce reacts to my Memes on the H3 Podcast.FM9VcagMxoc.mkv | 3.2M |
| 20171221.Big Shaq - Tingle Bells (Christmas Special).B_ggu02iW-g.mkv | 3.8M |
| 20171222.the ultimate virtual reality experience.LCPoTABRtrc.mkv | 1.6M |
| 20171227.Star Wars Meme.skowHnmtXWg.mkv | 301K |
| 20171231.The Top 10 Memes of 2017.Hrmn5qurzzc.mkv | 3.5M |
| 20180102.Logan Paul showed his child fans a body.VBuGa8b3avk.mkv | 1.5M |
| 20180105.What Logan Paul really saw in the forest (Meme).IE2KgfxS308.mkv | 959K |
| 20180107.try to imagine him in his underwear.dOMSrYh4YSM.mkv | 333K |
| 20180110.i know what men can do when they're angry.t4qAS_Ys6gs.mkv | 883K |
| 20180112.Uganda Knuckles - The Movie.0rUkpFMCFDo.mkv | 2.8M |
| 20180115.Anthony Fantano reviews Vsauce.aTt127qr5NE.mkv | 1.1M |
| 20180123.the current state of the internet.acmsVK0-S2E.mkv | 1.2M |
| 20180128.I love Vsauce ❤️.Kxz86RE0Cqw.mkv | 1.8M |
| 20180202.Pewdiepie ruins Star Wars.2N0d0zPrB1s.mkv | 1.7M |
| 20180203.I love Zucc ❤️.FZUeyTOZv2Y.mkv | 1.6M |
| 20180205.i can't believe you did this.cL5Yj-gMUrI.mkv | 1.6M |
| 20180210.Harry Potter and the Goblet of Meme.OLa8N_GylsQ.mkv | 1.8M |
| 20180217.Obama unveils his new portrait.JPpmktdtEWE.mkv | 1.4M |
| 20180218.Obama unveils another new portrait.VqYR9pPkfOk.mkv | 1.7M |
| 20180222.there's a white man standing in the street.UGADuB0cWAQ.mkv | 1.5M |
| 20180223.Wait for it...L8zonkmYN0g.mkv | 550K |
| 20180226.never do this if you are a white person.JKyzl6ARHwQ.mkv | 1.6M |
| 20180301.Ralph visits the Internet.PAkdzMXpMgg.mkv | 1.3M |
| 20180302.always be honest.HswV1M8O7Sk.mkv | 2.0M |
| 20180303.the scariest thing imaginable.VLFlcuKpKIA.mkv | 469K |
| 20180305.What's in the sack.Uf4q9RVlmrU.mkv | 1.4M |
| 20180307.Mrs. Incredible needs a favor.HWXkuHFBOXA.mkv | 874K |
| 20180309.Nintendo announces something amazing.t7XCBc7OPw4.mkv | 2.1M |
| 20180316.pewdiepie ruined my life again.fLLsZ31nr48.mkv | 2.0M |
| 20180319.when you can't turn your alarm off.dVPFYVBocjY.mkv | 1.6M |
| 20180322.That's the best Pirate I've ever seen.lWTSqhITw4g.mkv | 666K |
| 20180326.I don't think I can do that.c91Pwj0fRJI.mkv | 1.2M |
| 20180328.Always use Incognito mode.0etNuMwX21I.mkv | 1.0M |
| 20180401.CALLING OUT GRANDAYY.m_0kCUk5Qpg.mkv | 3.7M |
| 20180403.Trapped in Maxmoefoe's room.xnN66czpcMA.mkv | 1.4M |
| 20180407.I Donated $1 To My Favorite Twitch Streamer (ninja).Wb_Ev0L24k0.mkv | 1.9M |
| 20180409.I don't think I can do that 2.ibkdfY4uvUw.mkv | 1.2M |
| 20180411.Logan Paul streams for the first time.beeODAuJWz8.mkv | 1.8M |
| 20180412.YOU CAN'T DUCK THE ZUCC.7O4LQII6gLc.mkv | 2.1M |
| 20180416.The Best Meme Account is finally announced.udnwZC0bsfg.mkv | 1.5M |
| 20180420.a beautiful movie moment.yitVu39CrPk.mkv | 1.3M |
| 20180422.The problem with Fortnite #BOOGIEDOWN.3veLOowLSlg.mkv | 2.3M |
| 20180429.Do you like your new toy.JNLwlufdSjc.mkv | 540K |
| 20180501.They added Orange Shirt Kid to Fortnite.60D7U4tpuXM.mkv | 1.5M |
| 20180504.Marvel introduces a brand new hero.EgFtnbkr3xg.mkv | 1.4M |
| 20180506.The Musical Road.SPj0DEUmrOA.mkv | 1.8M |
| 20180508.Trumpet name.9MlVISvWgy0.mkv | 1.9M |
| 20180513.DON'T MOVE.Wm9sikdVE1A.mkv | 3.3M |
| 20180515.iDubbbz Green Screen Memes.my-FFDTn5EQ.mkv | 3.2M |
| 20180520.The Perfect Memory.j3gbVvHRkR4.mkv | 1.6M |
| 20180527.when you use the internet in 2018.aJr_AQFDMyQ.mkv | 1.3M |
| 20180604.More iDubbbz Memes.1DCZTtNxpf8.mkv | 3.5M |
| 20180605.Robot creates stunning work of art.CL0h6I-Xr74.mkv | 1.6M |
| 20180608.Vsauce Michael goes for a drive.BTQrwNoCYhw.mkv | 1.8M |
| 20180610.Creating the Perfect Painting.PoXkS6vX-FQ.mkv | 1.6M |
| 20180611.the biggest game reveal in the history of E3.RMmsJHc_UVk.mkv | 1.3M |
| 20180613.Sony's E3 presentation goes horribly wrong.zkQRi_nOhb8.mkv | 3.2M |
| 20180622.Trump and Kim sign a very important document.Vz2p4nCXcO0.mkv | 2.1M |
| 20180624.memes could be banned forever..LLcoKUCAczY.mkv | 1.6M |
| 20180626.pewdiepie is still trying to ruin my life.pxLJj48uBwk.mkv | 3.4M |
| 20180701.the most intense movie scene in history.84_4g5if8Zo.mkv | 1.5M |
| 20180710.The Pope isn't happy.sgx07FKCkd4.mkv | 946K |
| 20180712.Jacksfilms Fixed My Bio.w0i-n6ecro8.mkv | 2.2M |
| 20180716.Mr. Incredible finds out the truth.YtMCL9GHSS0.mkv | 1.3M |
| 20180721.Phil Swift from Flex Tape loses his mind.3xKS_YAvwW8.mkv | 1.7M |
| 20180723.PEWDIEPIE GOT LIGMA.09UkXDBV5dw.mkv | 2.3M |
| 20180725.this movie scene will make you cry.BxlCm7iR6MY.mkv | 1.6M |
| 20180801.gamecube intro meme but its for 12 year olds.U_qvlR3MrnA.mkv | 1.0M |
| 20180803.What does this monster have to mourn.iwYlMK98HNA.mkv | 2.0M |
| 20180804.Jacksepticeye is better than pewdiepie.OY8TYZg9GRU.mkv | 3.1M |
| 20180809.GRANDAYY MUST BE STOPPED.dKmVKMp36Ao.mkv | 2.0M |
| 20180811.Every Meme Is Here!.wTq5X_2Wi48.mkv | 2.3M |
| 20180816.the best meme creator is finally revealed.mvNGYjzQkk8.mkv | 2.6M |
| 20180824.the cursed video tape.wY0O7aB-kjI.mkv | 1.0M |
| 20180825.Jake Paul vs. Deji Memes.dMz9mKXYCMg.mkv | 2.7M |
| 20180826.you can't make memes about Logan Paul vs. KSI.v8Ed6V5ZL3s.mkv | 1.2M |
| 20180830.the worst surprise you could possibly get.60LRk2STXS8.mkv | 2.1M |
| 20180831.Let me guess... your home.rjpgslqeOXk.mkv | 1.4M |
| 20180902.JOHNY JOHNY YES PAPA meme.w47IpPuOm8M.mkv | 1.4M |
| 20180904.HEY GUYS, MASSIVE LEGEND HERE.XIdqnuTTrfA.mkv | 1.7M |
| 20180908.i improved the fortnite default dance music.p-2yKoMs2mM.mkv | 1.6M |
| 20180910.the internet used to be beautiful.v2WnktSaWk8.mkv | 1.3M |
| 20180911.Kanye West & Lil Pump Memes.c2aUmB5zJxw.mkv | 1.5M |
| 20180916.Do you remember Bongo Cat.TmsSlL8VWyI.mkv | 797K |
| 20180918.Spiderman gets some bad news.PdG1R7maIZs.mkv | 2.2M |
| 20180921.responding to pewdiepie.Nt4t3fpol-k.mkv | 2.0M |
| 20180928.fortnite isn't for kids anymore...msqXDSqC7sQ.mkv | 1.8M |
| 20181001.Why do good girls like bad guys.ByhcEDVp_YI.mkv | 1.9M |
| 20181009.Spiderman Memes.8J4HN-Zge1g.mkv | 3.7M |
| 20181013.TikTok must be stopped.0mESPi-HQOk.mkv | 1.8M |
| 20181020.The Memes of Jake Paul.7cFKT7eLIHM.mkv | 3.7M |
| 20181026.what are you.h--AwiAuhmM.mkv | 1.3M |
| 20181031.Dootbumps.l1pUeEnJYuc.mkv | 3.3M |
| 20181101.ATTENTION ALL MEME LOVERS ‼️⚠️🛑.lX-GSzeQvu8.mkv | 2.1M |
| 20181104.my final pyrocynical meme...N0NrQ_ZIc7k.mkv | 2.8M |
| 20181106.Super Smash Bros - World of Meme.ExmgqAzDMd8.mkv | 3.0M |
| 20181107.the dark truth about pewdiepie.hidj6aV5Bjw.mkv | 3.2M |
| 20181109.thank you for 1 million subscribers.yaRsC62YEUY.mkv | 4.8M |
| 20181111.What does the sun sound like.OVlHSWnAJcs.mkv | 1.5M |
| 20181113.Pikachu gets a new voice actor.h37A9Qjxsvo.mkv | 2.0M |
| 20181116.I paid random people to recreate TikTok memes.4JYWnfhDBz8.mkv | 2.4M |
| 20181128.Thank you for everything Stephen Hillenburg._kZ3fwIg7qY.mkv | 2.6M |
| 20181129.They did surgery on a grape.QrYQW9GLNbU.mkv | 1.7M |
| 20181204.T series almost passes Pewdiepie in subscribers.hGz7ZPb80l8.mkv | 1.0M |
| 20181220.Never live next to a gamer.zFGPdb5xaOc.mkv | 854K |
| 20181228.Youtube Rewind 2018 but it's actually good (Dolan's part).fOKWyP7CxOQ.mkv | 3.8M |
| 20190107.That's how mafia city works.WFLd6r6c1TI.mkv | 2.6M |
| 20190112.Logan Paul has gone too far.e5C7ZKx4TTQ.mkv | 2.7M |
| 20190127.that’s the cutest thing I’ve ever seen.Jo_VmpX5d2E.mkv | 1.9M |
| 20190131.pewdiepie got help from the person you'd least expect.lslkAICRNZo.mkv | 2.6M |
| 20190201.i ruined grandayy's fortnite game._lVTdNyk_58.mkv | 3.2M |
| 20190204.Job Search for Youtubers.3y6l6bmIs8w.mkv | 1.5M |
| 20190206.Paying tribute to Minecraft in Fortnite Creative Mode.v2DRVHnOL-A.mkv | 4.8M |
| 20190218.Y'all mind if I summon a genie.lPwuwoa822w.mkv | 1.3M |
| 20190224.Elon Musk finally hosted Meme Review.SOK3CJu8H1U.mkv | 2.1M |
| 20190303.You never know what is gonna come through that door.kEaZYb0WhAM.mkv | 295K |
| 20190312.The Most Cursed Minecraft Video.hZzPW09SHmg.mkv | 1.5M |
| 20190314.when you see a nice meme.HrNnY60jIQE.mkv | 1.1M |
| 20190328.Article 13 just ruined pewdiepie's career.HL393yIGr6Y.mkv | 1.6M |
| 20190331.I React to Elders React to Dolan Dark.FN1CqL7QTcA.mkv | 7.7M |
| 20190404.never forget your duolingo lessons.4E4MBmFSBSI.mkv | 1.1M |
| 20190409.here's the mf tea.n0QIc3FSdOo.mkv | 1.1M |
| 20190411.The first ever photo of a Black Hole was revealed and it's epic.pM-eM-SyIsA.mkv | 1.5M |
| 20190414.Here we go again.._LrSY9XY40s.mkv | 1.3M |
| 20190504.i improved the Sonic the Hedgehog trailer.a5IFnNawu24.mkv | 1.8M |
| 20190508.some people take endgame spoilers too seriously (ft. maxmoefoe).sdm1Tjq-UM4.mkv | 3.3M |
| 20190513.James Charles - The Movie.9j4O7pVr9AM.mkv | 1.9M |
| 20190524.Jake Paul will be cancelled after this.vluJc5r35Hs.mkv | 3.1M |
| 20190601.Aladdin takes a big risk.CZx41MTjffk.mkv | 1.6M |
| 20190630.Wreck-It Ralph becomes a Youtuber.d1bKwBl2xDM.mkv | 1.4M |
| 20190710.i bought Belle Delphine's bathwater.8fzM4KzH5ks.mkv | 2.6M |
| 20190727.GRANDAYY MUST BE STOPPED.njuazCAdHrg.mkv | 6.2M |
| 20190803.Ninja makes a huge announcement.vJRQZARRfzQ.mkv | 3.1M |
| 20190808.'Video games cause violence'.c474J3QEY3I.mkv | 2.4M |
| 20190823.Spiderman reacts to leaving the MCU.WavYzV1E-NE.mkv | 1.6M |
| 20190829.The Forbidden Music.cR3KiQwQXRo.mkv | 1.2M |
| 20190904.if internet memes existed in the 80s.CoOv4nm-kBk.mkv | 964K |
| 20190909.i got banned on twitter...Kwtp1qFYFhI.mkv | 1.7M |
| 20190917.Don't ask who Joe is..QcF_xAOQWyk.mkv | 1.6M |
| 20190922.this meme is too controversial for most people.Bg5de599LCo.mkv | 1.4M |
| 20190924.What really happened at Area 51.EnwXieiXvYQ.mkv | 1.1M |
| 20191005.Don't meme and drive.dUwWNJm6Cq4.mkv | 633K |
| 20191031.Goodnight girl, i won't see you tomorrow.WKF3XLpqVb8.mkv | 1.5M |
| 20191115.Gender reveals have gotten out of control.vAsvIi1b5D4.mkv | 1.7M |
| 20191128.Spiderman makes a huge mistake.ZGBzIcXqquY.mkv | 1.5M |
| 20191203.Baby Yoda must be stopped.9dDU8PJXgsM.mkv | 1.1M |
| 20191217.when you watch a youtube video in current year.oQwiNnvjkag.mkv | 1.0M |
| 20200203.What do famous people eat at Mcdonald's.SvLL5kfpqlA.mkv | 1.1M |
| 20200213.Mummy Speaks For First Time in 3,000 years (meme).GTIvsoLvXSM.mkv | 1.5M |
| 20200218.How Many Holes Does Vsauce Have.67zK5tLDQp0.mkv | 2.0M |
| 20200222.Killer Bean but it's a war movie.gUWBo7Q7xLM.mkv | 3.3M |
| 20200306.Live streaming will never be the same.x70N5SBhp3E.mkv | 1.0M |
| 20200308.The Ice Age Baby finally gets what he deserves.bgmjnp2SCMg.mkv | 1.9M |
| 20200311.The OK Boomer Girl must be stopped.exdejcmnvpE.mkv | 854K |
| 20200324.Gamers during self isolation.aeyW-taa28w.mkv | 2.5M |
| 20200409.How to get a gamer girlfriend.V9pR0iyUSzY.mkv | 1.4M |
| 20200416.e-girl apologises for cheating.MftM1CQm7-s.mkv | 1.1M |
| 20200428.when you get an unexpected guest.txs8E2uUVvA.mkv | 1.6M |
| 20200430.The truth is finally out there.dYeNHMHHuc0.mkv | 1.0M |
| 20200503.What's your Super Power.USnr-d8p0FU.mkv | 1.1M |
| 20200508.Goodnight Siren Head, I'll see you tomorrow.iu1JJR62n3I.mkv | 1.0M |
| 20200512.We Need to Cancel Joji.MqDHEimqbx8.mkv | 1.9M |
| 20200520.Kylo Ren makes a tough decision.V9BbCSDlfcw.mkv | 261K |
| 20200522.H3H3 vs Keemstar - Who Won.IsYQrgutv6Q.mkv | 1.7M |
| 20200602.Trump finally finds the answer to world peace.Zk-B348hlgk.mkv | 1.5M |
| 20200612.The Playstation 5 Reveal was weird.4tpBcsYvESc.mkv | 1.1M |
| 20200616.this meme will give you nostalgia.P6SJHZECcB8.mkv | 1.5M |
| 20200622.i bought Belle Delphine's OnlyFans.hi7pZiPbmUw.mkv | 1.6M |
| 20200702.i improved The Last of Us Part II.sWLx4omBUj8.mkv | 1.1M |
| 20200707.Always has been..nKqgRGurk-U.mkv | 937K |
| 20200730.Carl from UP is a Simp.dS5gh3nDLjM.mkv | 1.6M |
| 20200801.When the Crash Bandicoot soundtrack kicks in.l1xVvaZSVFs.mkv | 781K |
| 20200813.Simp finds out Pokimane has a Boyfriend.MKNIZihkP0w.mkv | 1.4M |
| 20200822.Every Fall Guys game ever.79rKlJdfEuQ.mkv | 1.5M |
| 20200912.Walter White has a confession to make.NdydLEVf9wE.mkv | 932K |
| 20200914.Why do women only like Among Us.TDcRN9t2czc.mkv | 947K |
| 20200927.Never live next to Among Us players.S-IVhx_DgfY.mkv | 928K |
| 20201015.Your opinion matters.7ap104kCPlY.mkv | 1.3M |
| 20201103.Walter White finds out his son is a Simp.fOg7BBRYXD8.mkv | 1.1M |
| 20201112.Who really won the election.Au_xQrqr3hc.mkv | 1.1M |
|
|---|