![[ICO]](/icons/blank.gif) | Name | Size |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | - |
![[TXT]](/icons/text.gif) | mindwar.txt | 24K |
![[ ]](/icons/layout.gif) | magic in theory and practice.pdf | 689K |
| Mysteriy of the Goths part 4.pdf | 20M |
| Mysteriy of the Goths part 3.pdf | 64M |
| Mysteriy of the Goths part 2.pdf | 66M |
| Mysteriy of the Goths part 1.pdf | 60M |
![[ ]](/icons/unknown.gif) | Murphy's sex law.doc | 28K |
| Mondmagie.pdf | 1.1M |
| Modi Zoroastrian Books.pdf | 4.3M |
| Mindfulness of Breathing & Four Elements Meditation.pdf | 1.0M |
| Mind Control NLP & Hypnosis.pdf | 452K |
| Metta Bhavana, Loving-kindness Meditation.pdf | 1.6M |
| Memory Levels.doc | 23K |
| Medieval Social Structure and Achad's Tree of Life.pdf | 41K |
| Master Of Imagination.pdf | 13K |
| Masonic Tracing Boards.pdf | 96K |
| Martinism.doc | 24K |
| Marijuana BUDS for less.pdf | 88M |
| Manual of Zen Buddhism.pdf | 944K |
| Malkuth.pdf | 72K |
| Make Your Mind an Ocean.pdf | 449K |
| Maha Satipatthana Sutta.pdf | 2.6M |
| Magic of NLP Demystified.pdf | 12M |
| Magick and Physics.pdf | 161K |
| MANHOOD of Humanity.doc | 1.3M |
|
|---|