![[ICO]](/icons/blank.gif) | Name | Size |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | - |
![[DIR]](/icons/folder.gif) | M415 Functional composites/ | - |
| M414 Non-metal coatings/ | - |
| M413 Thermal processing of metals/ | - |
| M412 Metalcasting/ | - |
| M411 Oxide ceramics/ | - |
| M410 Solid state thermodynamics/ | - |
| M409 Thermoplastic polymers/ | - |
| M408 Adhesives/ | - |
| M407 Printing on surfaces/ | - |
| M406 Recycling of materials/ | - |
| M405 Packaging materials/ | - |
| M404 Materials selection/ | - |
| M403 Industrial design/ | - |
| M402 Sustainable development/ | - |
| M401 Corosion and coatings/ | - |
| M321 Composites manufacturing/ | - |
| M320 Nanocomposites/ | - |
| M319 Construction materials/ | - |
| M318 Glass technology/ | - |
| M317 Steel and alloys/ | - |
| M316 Powder metallurgy/ | - |
| M315 Biopolymers and elastomers/ | - |
| M314 Polymer coatings/ | - |
| M313 Properties of polymers/ | - |
| M312 Ceramics synthesis/ | - |
| M311 Mechanical metallurgy/ | - |
| M310 Nanomaterials and nanotechnology/ | - |
| M309 Solid state chemistry/ | - |
| M308 Solid state physics/ | - |
| M307 Introduction to final elements/ | - |
| M306 Graphic design/ | - |
| M305 Surface engineering/ | - |
| M304 Mechanical behavior of materials/ | - |
| M303 Insturmental methods/ | - |
| M302 Composites/ | - |
| M301 Transport phenomena/ | - |
| M213 Polymers/ | - |
| M212 Ceramics/ | - |
| M211 Metals/ | - |
| M210 Introduction to materials engineering/ | - |
| G402 Manufacturing systems design/ | - |
| G401 Managerial economics and management/ | - |
| G209 Physical chemistry/ | - |
| G208 Organic chemistry/ | - |
| G207 Differential equations/ | - |
| G206 Probability and statistics/ | - |
| G205 MATLAB with numerical methods/ | - |
| G204 Electircal and electrronics engineering/ | - |
| G203 Engineering economics/ | - |
| G202 Thermodynamics/ | - |
| G201 Analytical chemistry/ | - |
| G105 Sociology/ | - |
| G104 Engineer drawing and process equipment design/ | - |
| G103 Physics/ | - |
| G102 Calculus/ | - |
| G101 General chemistry/ | - |
| Additional/ | - |
|
|---|