![[ICO]](/icons/blank.gif) | Name | Size |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | - |
![[IMG]](/icons/image2.gif) | 200 excercises in mechanistic organic chemistry.djvu | 507K |
![[ ]](/icons/layout.gif) | A Guidebook to Mechanism in Organic Chemistry.pdf | 6.3M |
| Advanced Organic Chemistry Vol A (Carey).djvu | 11M |
| Advanced Organic Chemistry Vol B (Carey).djvu | 8.4M |
| Advanced laboratory manual of organic chemistry.pdf | 934K |
| Autocatalytic Oxidation of Ethers with Sodium Bromate.pdf | 115K |
| Cycloaddition Reactions in Organic Synthesis (S. Kobayashi & K. A. Jorgensen).pdf | 3.4M |
| Cycloaddition reactions in organic synthesis - K.A Jorgensen.djvu | 2.3M |
| Designing organic syntheses.djvu | 447K |
| Enamines - Synthesis structure and reactions - A.G Cook.djvu | 4.2M |
| Excercises in organic synthesis.djvu | 168K |
| Glycerine, Its Production, Uses And Examination by Koppe.pdf | 8.1M |
| HeckReactionandCinnamicAcid.pdf | 2.0M |
| Imidazole and Benzimidazole Synthesis.djvu | 3.1M |
| James Zubrick - Organic Chem Lab Survival Guide [2E OCR].pdf | 4.8M |
| Laboratory preparations of Thiophene compounds.djvu | 280K |
| Mechanism and theory in organic chemistry T.H Lowry 3rd edt.djvu | 8.3M |
| Methoden der organischen chemie Vol E10a.djvu | 12M |
| Neuroscience of psychoactive substance use and dependence - WHO 2004.pdf | 1.8M |
| Nitration_and_aromatic_reactivity_by_Hoggett.pdf | 3.1M |
| Nitration and aromatic chemistry - J.G Hoggett.djvu | 1.7M |
| Nitro_group_in_organic_synth.pdf | 4.5M |
| Nitro_group_in_organic_synthesis.pdf | 4.5M |
| Organic Chem Lab Survival Guide - James Zubrick [2E OCR].pdf | 4.8M |
| Organic Chemistry (Bruice).pdf | 26M |
| Organic Chemistry (Schaum).pdf | 18M |
| Organic Chemistry (Solomons).pdf | 18M |
![[ ]](/icons/compressed.gif) | Organic_Chemistry_E-Textbook_-_Francis_Carey.zip | 29M |
| Organic syntheses based on name reactions and unnamed reactions - A. Hassner.djvu | 3.5M |
| Organic synthesis - concepts methods starting materials.djvu | 5.6M |
| Organische synthesen mit cyansaureestern - D. Martin.djvu | 2.4M |
| Oxidations in Organic Chemistry (Hudlicky).djvu | 5.2M |
| Palladium reagents and catalysts - innovations in organic synthesis - J. Tsuji.djvu | 5.4M |
| Practical Organic Chemistry (Vogel).pdf | 16M |
| Principles And Applications Of Asymmetric Synthesis.pdf | 23M |
| Principles and Applications of Assymetric Synthesis.djvu | 2.4M |
| StructureByNMR.djvu | 2.3M |
| Synthesis of Organometallic Compounds.pdf | 18M |
| Synthetic Applications of 1,3-Dipolar Cycloaddition Chemistry Toward Heterocycles and Natural Products.pdf | 6.7M |
![[ ]](/icons/unknown.gif) | SynthetikalOffline-07102005-search.rar | 7.0M |
| Systematic_Organic_Chemistry_Cumming__Hopper_Wheeler.djvu | 4.8K |
| Tetrachlorodinitroethane - Credit to Mega.pdf | 383K |
| The Properties of Solvents by Yizhak Marcus (Wiley).pdf | 3.2M |
| The chemistry of organic germanium, tin and lead compounds Vol 1.djvu | 5.7M |
| The chemistry of the amino group (Patai, 1968).pdf | 12M |
| The recent advance in Phosgene Chemistry.djvu | 1.2M |
| Thiazole and its derivatives part 1.djvu | 5.7M |
| Thiazole and its derivatives part 2.djvu | 5.6M |
| Thiazole and its derivatives part 3.djvu | 4.2M |
| catalysis of Diels-Alder reactions in water R. Groningen.djvu | 907K |
| new developments in the chemistry of war gasses - 1950.pdf | 104K |
| the_synthetic_use_of_metals_in_organic_chemistry.pdf | 1.6M |
|
|---|