![[ICO]](/icons/blank.gif) | Name | Size |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | - |
![[ ]](/icons/layout.gif) | Ch32-Digestion and Transport of Dietary Lipids.pdf | 7.8M |
| Ch37-Protein Digestion and Amino Acid Absorption.pdf | 7.7M |
| Ch12-Structure of the Nucleic Acids.pdf | 5.5M |
![[ ]](/icons/unknown.gif) | CH26-B~1.PDF | 4.3M |
| Ch43-Actions of Hormones Regulating Fuel Metabolism.pdf | 4.2M |
| Ch19-Cellular Bioenergetics ATP and O2.pdf | 4.0M |
| Ch11-Cell Signaling by Chemical Messengers.pdf | 1.7M |
| Ch44-The Biochemistry of the Erythrocyte and Other Blood Cells.pdf | 1.2M |
| Ch08-Enzymes as Catalysts.pdf | 1.0M |
| Ch16-Regulation of Gene Expression.pdf | 896K |
| Ch10-Relationship between Cell Biology and Biochemistry.pdf | 817K |
| Ch38-Fate of Amino Acid Nitrogen - Urea Cycle.pdf | 724K |
| Ch07-Structure-Function Relationships in Proteins.pdf | 718K |
| Ch31-Gluconeogenesis and Maintenance of Blood Glucose Levels.pdf | 716K |
| Ch42-Intertissue Relationships in the Metabolism of Amino Acids.pdf | 679K |
| Ch33-Synthesis of Fatty Acids, Triacylglycerols, and the Major Membrane Lipids.pdf | 449K |
| Ch34-Cholesterol Absorption, Synthesis, Metabolism, and Fate.pdf | 440K |
| Ch17-Use of Recombinant DNA Techniques in Medicine.pdf | 425K |
| Ch14-Transcription Synthesis of RNA.pdf | 402K |
| Ch28-Formation and Degradation of Glycogen.pdf | 397K |
| Ch24-Oxygen Toxicity and Free Radical Damage.pdf | 393K |
| Ch49-The Extracellular Matrix and Connective Tissue.pdf | 388K |
| Ch23-Oxidation of Fatty Acids and Ketone Bodies.pdf | 369K |
| Ch01-Metabolic Fuels and Dietary Components.pdf | 354K |
| Ch18-The Molecular Biology of Cancer.pdf | 349K |
| Ch25-Metabolism of Ethanol.pdf | 346K |
| Ch47-Metabolism of Muscle at Rest and During Exercise.pdf | 339K |
| Ch22-Generation of ATP from Glucose Glycosis.pdf | 337K |
| Ch13-Synthesis of DNA.pdf | 328K |
| Ch21-Oxidative Phosphorylation and Mitochondrial Function.pdf | 317K |
| Ch48-Metabolism of the Nervous System.pdf | 308K |
| Ch06-Amino Acids in Proteins.pdf | 303K |
| Ch20-Tricarboxylic Acid Cycle.pdf | 300K |
| Ch09-Regulation of Enzymes.pdf | 298K |
| Ch27-Digestion, Absorption, and Transport of Carbohydrates.pdf | 294K |
| Ch45-Blood Plasma Proteins, Coagulation and Fibrinolysis.pdf | 284K |
| Ch05-Structures of the Major Compounds of the Body.pdf | 271K |
| Ch39-Synthesis and Degradation of Amino Acids.pdf | 268K |
| Ch15-Translation - Synthesis of Proteins.pdf | 267K |
| Ch04-Water, Acids, Bases, and Buffers.pdf | 263K |
| Ch30-Synthesis of Glycosides, Lactose, Glycoproteins, and Glycolipids.pdf | 227K |
| Ch46-Liver Metabolism.pdf | 222K |
| Ch40-Tetrahydrofolate, Vitamin B12, and S-Adenosylmethionine.pdf | 221K |
| CH29-P~1.PDF | 207K |
| Ch36-Integration of Carbohydrate and Lipid Metabolism.pdf | 203K |
| Ch41-Purine and Pyrimidine Metabolism.pdf | 200K |
| Ch35-Metabolism of the Eicosanoids.pdf | 192K |
| Ch02-The Fed or Absorptive State.pdf | 173K |
| Ch03-Fasting.pdf | 166K |
| _0TOC.pdf | 62K |
|
|---|